1,2-Methylenedioxy-3,10,11-trimethoxyaporphine

Catalog Number	ACM14050909
CAS Number	14050-90-9
Synonyms	10-O-Methylhernandine
IUPAC Name	7,17,18-trimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14(19),15,17-hexaene
Molecular Weight	355.38
Molecular Formula	C20H21NO5
Canonical SMILES	COC1=C(C2=C(CC3C4=C(CCN3)C(=C5C(=C42)OCO5)OC)C=C1)OC
InChI	InChI=1S/C20H21NO5/c1-22-13-5-4-10-8-12-15-11(6-7-21-12)17(23-2)20-19(25-9-26-20)16(15)14(10)18(13)24-3/h4-5,12,21H,6-9H2,1-3H3
InChI Key	CHTZCWLHHIYAJY-UHFFFAOYSA-N
Purity	98%
Appearance	Solid
Complexity	518
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	355.14197277
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Monoisotopic Mass	355.14197277
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	58.2 Ų

Custom Q&A

What is the full chemical name of this compound?

The full chemical name of this compound is 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine.

What are some synonyms for 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

Some synonyms for 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine are 10-O-Methylhernandine and 1,2-Methylenedioxy-3,10,11-triMethoxynoraporphine.

What is the CAS number of this compound?

The CAS number of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 14050-90-9.

What is the molecular formula of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

The molecular formula of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is C20H21NO5.

What is the molecular weight of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

The molecular weight of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 355.38.

What is the predicted boiling point of this compound?

The predicted boiling point of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 525.4±50.0 °C.

What is the predicted density of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

The predicted density of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 1.283±0.06 g/cm3.

What is the predicted pKa value of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

The predicted pKa value of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 6.71±0.20.

What are some chemical properties of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

Some chemical properties of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine include boiling point, density, and pKa value.

※ Please kindly note that our products are for research use only.