1,2-Methylenedioxy-3,10,11-trimethoxyaporphine

1,2-Methylenedioxy-3,10,11-trimethoxyaporphine

Inquiry
Catalog Number ACM14050909
CAS Number 14050-90-9
Structure
Synonyms 10-O-Methylhernandine
IUPAC Name 7,17,18-trimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14(19),15,17-hexaene
Molecular Weight 355.38
Molecular Formula C20H21NO5
Canonical SMILES COC1=C(C2=C(CC3C4=C(CCN3)C(=C5C(=C42)OCO5)OC)C=C1)OC
InChI InChI=1S/C20H21NO5/c1-22-13-5-4-10-8-12-15-11(6-7-21-12)17(23-2)20-19(25-9-26-20)16(15)14(10)18(13)24-3/h4-5,12,21H,6-9H2,1-3H3
InChI Key CHTZCWLHHIYAJY-UHFFFAOYSA-N
Purity 98%
Appearance Solid
Complexity 518
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 355.14197277
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 1
Monoisotopic Mass 355.14197277
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 58.2 Ų
Custom Q&A

What is the full chemical name of this compound?

The full chemical name of this compound is 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine.

What are some synonyms for 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

Some synonyms for 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine are 10-O-Methylhernandine and 1,2-Methylenedioxy-3,10,11-triMethoxynoraporphine.

What is the CAS number of this compound?

The CAS number of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 14050-90-9.

What is the molecular formula of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

The molecular formula of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is C20H21NO5.

What is the molecular weight of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

The molecular weight of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 355.38.

What is the predicted boiling point of this compound?

The predicted boiling point of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 525.4±50.0 °C.

What is the predicted density of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

The predicted density of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 1.283±0.06 g/cm3.

What is the predicted pKa value of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

The predicted pKa value of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine is 6.71±0.20.

What are some chemical properties of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine?

Some chemical properties of 1,2-Methylenedioxy-3,10,11-trimethoxyaporphine include boiling point, density, and pKa value.

※ Please kindly note that our products are for research use only.