1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one

Catalog Number	ACM1189362864
CAS Number	1189362-86-4
Structure
Synonyms	9(10H)-Acridinone, 1,3-dihydroxy-4-methoxy-10-methyl-
IUPAC Name	1,3-Dihydroxy-4-methoxy-10-methylacridin-9-one
Molecular Weight	271.27
Molecular Formula	C15H13NO4
Canonical SMILES	CN1C2=CC=CC=C2C(=O)C3=C1C(=C(C=C3O)O)OC
InChI	InChI=1S/C15H13NO4/c1-16-9-6-4-3-5-8(9)14(19)12-10(17)7-11(18)15(20-2)13(12)16/h3-7,17-18H,1-2H3
InChI Key	YIBYVKSDVRSLGT-UHFFFAOYSA-N
Purity	98%
Appearance	Solid
Complexity	388
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	271.0844579
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Monoisotopic Mass	271.0844579
PhysicalState	Solid
Rotatable Bond Count	1
Topological Polar Surface Area	70 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 1189362-86-4?

The chemical name is 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one.

What are some synonyms for 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one?

Some synonyms include 1,3-DIHYDROXY-4-METHOXY-10-METH and 1,3-dihydroxy-4-methoxy-10-methylacridin-9-one.

What is the molecular formula of 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one?

The molecular formula is C15H13NO4.

What is the molecular weight of 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one?

The molecular weight is 271.27 g/mol.

What is the predicted boiling point of 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one?

The predicted boiling point is 510.9±50.0 °C.

What is the predicted density of 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one?

The predicted density is 1.394±0.06 g/cm3.

What is the predicted pKa value of 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one?

The predicted pKa value is 7.81±0.20.

Why is 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one used in research?

It is used in research due to its unique chemical properties and potential applications in various fields.

How can 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one be synthesized?

It can be synthesized through organic chemical reactions involving specific starting materials and reaction conditions.

What are some potential uses of 1,3-Dihydroxy-4-methoxy-10-methylacridin-9(10H)-one in industry?

It may have applications as a precursor in the synthesis of other compounds, as a reactive intermediate, or as a fluorescent material.

※ Please kindly note that our products are for research use only.