1-Cinnamoyl-3-hydroxypyrrolidine

Catalog Number	ACM1344876772
CAS Number	1344876-77-2
Structure
Synonyms	1-(3-Hydroxy-1-pyrrolidinyl)-3-phenyl-2-propen-1-one
IUPAC Name	(E)-1-(3-hydroxypyrrolidin-1-yl)-3-phenylprop-2-en-1-one
Molecular Weight	217.26
Molecular Formula	C13H15NO2
Canonical SMILES	C1CN(CC1O)C(=O)/C=C/C2=CC=CC=C2
InChI	InChI=1S/C13H15NO2/c15-12-8-9-14(10-12)13(16)7-6-11-4-2-1-3-5-11/h1-7,12,15H,8-10H2/b7-6+
InChI Key	FHARWVZPAKTDJR-VOTSOKGWSA-N
Boiling Point	442.7±44.0 °C
Purity	98%
Density	1.228±0.06 g/ml
Appearance	Solid
Complexity	269
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	217.110278721
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C1CN(CC1O)C(=O)/C=C/C2=CC=CC=C2
Monoisotopic Mass	217.110278721
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	40.5 Ų

Custom Q&A

What is the product name of the chemical compound with the CAS number 1344876-77-2?

The product name is 1-CinnaMoyl-3-hydroxypyrrolidine.

What are some synonyms for 1-CinnaMoyl-3-hydroxypyrrolidine?

Some synonyms include 1-(3-Hydroxy-1-pyrrolidinyl)-3-phenyl-2-propen-1-one and (2e)-1-(3-hydroxypyrrolidin-1-yl)-3-phenylprop-2-en-1-one.

What is the molecular formula of 1-CinnaMoyl-3-hydroxypyrrolidine?

The molecular formula is C13H15NO2.

What is the molecular weight of 1-CinnaMoyl-3-hydroxypyrrolidine?

The molecular weight is 217.26.

What is the boiling point of 1-CinnaMoyl-3-hydroxypyrrolidine?

The boiling point is predicted to be 442.7±44.0 °C.

What is the density of 1-CinnaMoyl-3-hydroxypyrrolidine?

The density is predicted to be 1.228±0.06 g/cm3.

What is the pKa value of 1-CinnaMoyl-3-hydroxypyrrolidine?

The pKa value is predicted to be 14.53±0.20.

What is the chemical property related to the boiling point of 1-CinnaMoyl-3-hydroxypyrrolidine?

The boiling point is related to the temperature at which the compound transitions from a liquid to a gas.

How is the density of 1-CinnaMoyl-3-hydroxypyrrolidine predicted?

The density is predicted by calculating the mass per unit volume of the compound.

What does the pKa value of 1-CinnaMoyl-3-hydroxypyrrolidine indicate?

The pKa value indicates the acidity or basicity of the compound, with higher values suggesting stronger acidity.

※ Please kindly note that our products are for research use only.