1-Cinnamoylpyrrolidine

Catalog Number	ACM52438218
CAS Number	52438-21-8
Synonyms	1-[(2E)-1-Oxo-3-phenyl-2-propenyl]pyrrolidine
IUPAC Name	(E)-3-phenyl-1-pyrrolidin-1-ylprop-2-en-1-one
Molecular Weight	201.26
Molecular Formula	C13H15NO
Canonical SMILES	C1CCN(C1)C(=O)/C=C/C2=CC=CC=C2
InChI	InChI=1S/C13H15NO/c15-13(14-10-4-5-11-14)9-8-12-6-2-1-3-7-12/h1-3,6-9H,4-5,10-11H2/b9-8+
InChI Key	JSIGICUAXLIURX-CMDGGOBGSA-N
Melting Point	123 °C
Purity	98%
Appearance	Solid
Complexity	235
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	201.115364102
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	0
Monoisotopic Mass	201.115364102
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	20.3 Ų

Custom Q&A

What is the chemical name of 1-cinnamoylpyrrolidine?

The chemical name of 1-cinnamoylpyrrolidine is 1-[(2E)-1-Oxo-3-phenyl-2-propenyl]pyrrolidine.

What is the CAS number of 1-cinnamoylpyrrolidine?

The CAS number of 1-cinnamoylpyrrolidine is 52438-21-8.

What is the molecular formula of 1-cinnamoylpyrrolidine?

The molecular formula of 1-cinnamoylpyrrolidine is C13H15NO.

What is the molecular weight of 1-cinnamoylpyrrolidine?

The molecular weight of 1-cinnamoylpyrrolidine is 201.26.

What are the product categories that 1-cinnamoylpyrrolidine falls under?

1-cinnamoylpyrrolidine falls under the category of Alkaloids.

What is the melting point of 1-cinnamoylpyrrolidine?

The melting point of 1-cinnamoylpyrrolidine is 123℃.

How should 1-cinnamoylpyrrolidine be stored?

1-cinnamoylpyrrolidine should be stored at -20°C.

In what solvents is 1-cinnamoylpyrrolidine soluble?

1-cinnamoylpyrrolidine is soluble in Acetone, Chloroform, Dichloromethane, DMSO, and Ethyl Acetate.

How is 1-cinnamoylpyrrolidine related to cinnamic acid?

1-cinnamoylpyrrolidine is functionally related to cinnamic acid.

What is the form of 1-cinnamoylpyrrolidine?

The form of 1-cinnamoylpyrrolidine is a solid.

※ Please kindly note that our products are for research use only.