1-Ethoxycarbonyl-beta-carboline

Catalog Number	ACM72755192
CAS Number	72755-19-2
Synonyms	9H-Pyrido[3,4-b]indole-1-carboxylic acid ethyl ester
Molecular Weight	240.26
InChI	InChI=1S/C14H12N2O2/c1-2-18-14(17)13-12-10(7-8-15-13)9-5-3-4-6-11(9)16-12/h3-8,16H,2H2,1H3
InChI Key	CFXOOHNXLDSCHT-UHFFFAOYSA-N
Melting Point	145-146 °C
Purity	95%+
Complexity	321
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	240.08987763
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	240.08987763
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	55 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 72755-19-2?

The chemical name of the compound with the CAS number 72755-19-2 is 1-(Ethoxycarbonyl)-β-carboline.

What are some synonyms for 1-(Ethoxycarbonyl)-β-carboline?

Some synonyms for 1-(Ethoxycarbonyl)-β-carboline include 1-Ethoxycarbonyl-beta-carboline, ethyl 9H-pyrido[3,4-b]indole-1-carboxylate, and Carboline Impurity 1.

What is the molecular formula of 1-(Ethoxycarbonyl)-β-carboline?

The molecular formula of 1-(Ethoxycarbonyl)-β-carboline is C14H12N2O2.

What is the molecular weight of 1-(Ethoxycarbonyl)-β-carboline?

The molecular weight of 1-(Ethoxycarbonyl)-β-carboline is 240.26 g/mol.

What is the melting point of 1-(Ethoxycarbonyl)-β-carboline?

The melting point of 1-(Ethoxycarbonyl)-β-carboline is 145-146°C.

What is the predicted boiling point of 1-(Ethoxycarbonyl)-β-carboline?

The predicted boiling point of 1-(Ethoxycarbonyl)-β-carboline is 470.9±25.0°C.

What is the predicted density of 1-(Ethoxycarbonyl)-β-carboline?

The predicted density of 1-(Ethoxycarbonyl)-β-carboline is 1.308±0.06 g/cm3.

What is the predicted pka value of 1-(Ethoxycarbonyl)-β-carboline?

The predicted pka value of 1-(Ethoxycarbonyl)-β-carboline is 14.21±0.40.

What is the common use of 1-(Ethoxycarbonyl)-β-carboline in research or industry?

1-(Ethoxycarbonyl)-β-carboline is commonly used as a carboline impurity.

Can 1-(Ethoxycarbonyl)-β-carboline be used as a reference compound for other reactions or studies?

Yes, 1-(Ethoxycarbonyl)-β-carboline can be used as a reference compound or standard in various reactions or studies in the laboratory.

※ Please kindly note that our products are for research use only.