1-Hydroxy-10-methylacridone

Catalog Number	ACM16584546-1
CAS Number	16584-54-6
Structure
Synonyms	1-Hydroxy-10-methylacridin-9(10H)-one
Molecular Weight	225.24
InChI	InChI=1S/C14H11NO2/c1-15-10-6-3-2-5-9(10)14(17)13-11(15)7-4-8-12(13)16/h2-8,16H,1H3
InChI Key	NHYDBJFGZCQFEO-UHFFFAOYSA-N
Purity	95%+
Complexity	317
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	225.078978594
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	225.078978594
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	40.5 Ų

Custom Q&A

What is the chemical name of 1-Hydroxy-10-methylacridone?

The chemical name of 1-Hydroxy-10-methylacridone is 1-Hydroxy-10-methyl-10H-acridin-9-one.

What are some synonyms for 1-Hydroxy-10-methylacridone?

Some synonyms for 1-Hydroxy-10-methylacridone include 1-Hydroxy-10-methyl-9(10H)-acridone, 1-Hydroxy-N-methylrutacridone, and 1-Hydroxy-N-methylacridone.

What is the CAS number for 1-Hydroxy-10-methylacridone?

The CAS number for 1-Hydroxy-10-methylacridone is 16584-54-6.

What is the molecular formula of 1-Hydroxy-10-methylacridone?

The molecular formula of 1-Hydroxy-10-methylacridone is C14H11NO2.

What is the molecular weight of 1-Hydroxy-10-methylacridone?

The molecular weight of 1-Hydroxy-10-methylacridone is 225.24 g/mol.

What is the melting point of 1-Hydroxy-10-methylacridone?

The melting point of 1-Hydroxy-10-methylacridone is 131-132 °C.

What is the biling point of 1-Hydroxy-10-methylacridone?

The boiling point of 1-Hydroxy-10-methylacridone is predicted to be 428.4±34.0 °C.

What is the density of 1-Hydroxy-10-methylacridone?

The density of 1-Hydroxy-10-methylacridone is predicted to be 1.309±0.06 g/cm3.

What is the pka of 1-Hydroxy-10-methylacridone?

The pka of 1-Hydroxy-10-methylacridone is predicted to be 7.73±0.20.

According to ChEBI, how is 1-Hydroxy-10-methylacridone related to acridines?

According to ChEBI, 1-Hydroxy-10-methylacridone is a member of acridines and is functionally related to an acridone.

※ Please kindly note that our products are for research use only.