1-Hydroxy-9-medroxycanthin-6-one

Catalog Number	ACM622408859
CAS Number	622408-85-9
Synonyms	1-Hydroxy-9-methoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one
Molecular Weight	266.25
InChI	InChI=1S/C15H10N2O3/c1-20-8-2-3-9-11(6-8)17-13(19)5-4-10-15(17)14(9)12(18)7-16-10/h2-7,18H,1H3
InChI Key	KFHGYFDVGYKREV-UHFFFAOYSA-N
Purity	95%+
Complexity	452
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	266.06914219
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	266.06914219
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	64.4 Ų

Custom Q&A

What is the full name of the compound with the CAS number 622408-85-9?

The full name of the compound with the CAS number 622408-85-9 is 1-Hydroxy-9-medroxycanthin-6-one.

What are the synonyms for 1-Hydroxy-9-medroxycanthin-6-one?

The synonyms for 1-Hydroxy-9-medroxycanthin-6-one are 1-Hydroxy-9-methoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one and 6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 1-hydroxy-9-methoxy-.

What is the PubChem ID for 1-Hydroxy-9-medroxycanthin-6-one?

The PubChem ID for 1-Hydroxy-9-medroxycanthin-6-one is 11448499.

What is the molecular formula of 1-Hydroxy-9-medroxycanthin-6-one?

The molecular formula of 1-Hydroxy-9-medroxycanthin-6-one is C15H10N2O3.

What is the molecular weight of 1-Hydroxy-9-medroxycanthin-6-one?

The molecular weight of 1-Hydroxy-9-medroxycanthin-6-one is 266.25.

How many carbon atoms are present in the molecular formula of 1-Hydroxy-9-medroxycanthin-6-one?

There are 15 carbon atoms present in the molecular formula of 1-Hydroxy-9-medroxycanthin-6-one.

What functional groups can be found in the structure of 1-Hydroxy-9-medroxycanthin-6-one?

In the structure of 1-Hydroxy-9-medroxycanthin-6-one, there is a hydroxyl group (-OH) and a methoxy group (-OCH3).

What is the chemical classification of 1-Hydroxy-9-medroxycanthin-6-one?

The chemical classification of 1-Hydroxy-9-medroxycanthin-6-one is a naphthyridin-6-one derivative.

What is the significance or potential applications of 1-Hydroxy-9-medroxycanthin-6-one?

The potential applications of 1-Hydroxy-9-medroxycanthin-6-one could include pharmaceutical research, as naphthyridin-6-one derivatives have shown various biological activities.

※ Please kindly note that our products are for research use only.