1-Hydroxycanthin-6-one

Catalog Number	ACM80787593
CAS Number	80787-59-3
Synonyms	1-Hydroxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one
IUPAC Name	8-Hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one
Molecular Weight	236.23
Molecular Formula	C14H8N2O2
Canonical SMILES	C1=CC=C2C(=C1)C3=C4N2C(=O)C=CC4=NC=C3O
InChI	InChI=1S/C14H8N2O2/c17-11-7-15-9-5-6-12(18)16-10-4-2-1-3-8(10)13(11)14(9)16/h1-7,17H
InChI Key	LWYFITNQEPSUDK-UHFFFAOYSA-N
Purity	98%
Appearance	Solid
Complexity	409
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	236.058577502
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	236.058577502
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	55.1 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 80787-59-3?

The chemical name of the compound with the CAS number 80787-59-3 is 1-Hydroxycanthin-6-one.

What are some synonyms for 1-Hydroxycanthin-6-one?

Some synonyms for 1-Hydroxycanthin-6-one are 6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 1-hydroxy- and 1-Hydroxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one.

What is the molecular formula of 1-Hydroxycanthin-6-one?

The molecular formula of 1-Hydroxycanthin-6-one is C14H8N2O2.

What is the molar mass of 1-Hydroxycanthin-6-one?

The molar mass of 1-Hydroxycanthin-6-one is 236.23 g/mol.

What category does 1-Hydroxycanthin-6-one belong to?

1-Hydroxycanthin-6-one belongs to the category of alkaloids.

What is the significance of the CAS number 80787-59-3?

The CAS number 80787-59-3 is a unique identifier assigned to 1-Hydroxycanthin-6-one for easy reference and identification.

How many carbon atoms are present in the chemical formula of 1-Hydroxycanthin-6-one?

The chemical formula of 1-Hydroxycanthin-6-one contains 14 carbon atoms.

What are some potential applications of 1-Hydroxycanthin-6-one?

Some potential applications of 1-Hydroxycanthin-6-one may include medicinal purposes or research in alkaloid chemistry.

What is the molecular weight of 1-Hydroxycanthin-6-one?

The molecular weight of 1-Hydroxycanthin-6-one is 236.23 g/mol.

※ Please kindly note that our products are for research use only.