1-Hydroxyrutaecarpine

Catalog Number	ACM53600241
CAS Number	53600-24-1
Synonyms	Indolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one, 8,13-dihydro-1-hydroxy-
IUPAC Name	19-hydroxy-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-14-one
Molecular Weight	303.31
Molecular Formula	C18H13N3O2
Canonical SMILES	C1CN2C(=NC3=C(C2=O)C=CC=C3O)C4=C1C5=CC=CC=C5N4
InChI	InChI=1S/C18H13N3O2/c22-14-7-3-5-12-15(14)20-17-16-11(8-9-21(17)18(12)23)10-4-1-2-6-13(10)19-16/h1-7,19,22H,8-9H2
InChI Key	IBBYAIMGJMOBLQ-UHFFFAOYSA-N
Boiling Point	601.7±65.0 °C
Purity	98%
Density	1.55±0.1 g/ml
Appearance	Solid
Complexity	548
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	303.100776666
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	303.100776666
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	68.7 Ų

Custom Q&A

What is the chemical name of 1-Hydroxyrutaecarpine?

The chemical name of 1-Hydroxyrutaecarpine is Indolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one, 8,13-dihydro-1-hydroxy-

What is the CAS number of 1-Hydroxyrutaecarpine?

The CAS number of 1-Hydroxyrutaecarpine is 53600-24-1

What is the molecular formula of 1-Hydroxyrutaecarpine?

The molecular formula of 1-Hydroxyrutaecarpine is C18H13N3O2

What is the molecular weight of 1-Hydroxyrutaecarpine?

The molecular weight of 1-Hydroxyrutaecarpine is 303.31

What is the predicted boiling point of 1-Hydroxyrutaecarpine?

The predicted boiling point of 1-Hydroxyrutaecarpine is 601.7±65.0 °C

In which solvents is 1-Hydroxyrutaecarpine soluble?

1-Hydroxyrutaecarpine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

In what form does 1-Hydroxyrutaecarpine exist?

1-Hydroxyrutaecarpine exists in powder form

What is the predicted pKa of 1-Hydroxyrutaecarpine?

The predicted pKa of 1-Hydroxyrutaecarpine is 8.80±0.20

What is the color of 1-Hydroxyrutaecarpine?

The color of 1-Hydroxyrutaecarpine is Yellow

What is the predicted density of 1-Hydroxyrutaecarpine?

The predicted density of 1-Hydroxyrutaecarpine is 1.55±0.1 g/cm3

※ Please kindly note that our products are for research use only.