1-Methoxyallocryptopine

Catalog Number	ACM56743523
CAS Number	56743-52-3
Synonyms	Benzo[c][1,3]benzodioxolo[5,6-g]azecin-14(6H)-one, 5,7,8,15-tetrahydro-3,4,13-trimethoxy-6-methyl-
IUPAC Name	7,8,21-trimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaen-2-one
Molecular Weight	399.44
Molecular Formula	C22H25NO6
Canonical SMILES	CN1CCC2=CC3=C(C(=C2C(=O)CC4=C(C1)C(=C(C=C4)OC)OC)OC)OCO3
InChI	InChI=1S/C22H25NO6/c1-23-8-7-14-10-18-21(29-12-28-18)22(27-4)19(14)16(24)9-13-5-6-17(25-2)20(26-3)15(13)11-23/h5-6,10H,7-9,11-12H2,1-4H3
InChI Key	LLTCRRPEZHDFFY-UHFFFAOYSA-N
Purity	98%
Appearance	Solid
Complexity	574
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	399.16818752
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Monoisotopic Mass	399.16818752
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	66.5 Ų

Custom Q&A

What is the chemical name of 1-Methoxyallocryptopine?

The chemical name of 1-Methoxyallocryptopine is Benzo[c][1,3]benzodioxolo[5,6-g]azecin-14(6H)-one, 5,7,8,15-tetrahydro-3,4,13-trimethoxy-6-methyl.

What is the molecular formula of 1-Methoxyallocryptopine?

The molecular formula of 1-Methoxyallocryptopine is C22H25NO6.

What is the molar mass of 1-Methoxyallocryptopine?

The molar mass of 1-Methoxyallocryptopine is 399.44 g/mol.

What is the CAS number of 1-Methoxyallocryptopine?

The CAS number of 1-Methoxyallocryptopine is 56743-52-3.

How many oxygen atoms are present in the molecular formula of 1-Methoxyallocryptopine?

There are six oxygen atoms present in the molecular formula of 1-Methoxyallocryptopine.

What is the molecular weight of 1-Methoxyallocryptopine?

The molecular weight of 1-Methoxyallocryptopine is 399.44 g/mol.

What is the chemical structure of 1-Methoxyallocryptopine?

The chemical structure of 1-Methoxyallocryptopine is Benzo[c][1,3]benzodioxolo[5,6-g]azecin-14(6H)-one, 5,7,8,15-tetrahydro-3,4,13-trimethoxy-6-methyl.

Is 1-Methoxyallocryptopine a natural product or synthetic compound?

1-Methoxyallocryptopine is a natural product.

How many hydrogen atoms are present in the molecular formula of 1-Methoxyallocryptopine?

There are 25 hydrogen atoms present in the molecular formula of 1-Methoxyallocryptopine.

※ Please kindly note that our products are for research use only.