1-Methoxyindoleacetonitrile

Catalog Number	ACM30536482
CAS Number	30536-48-2
Structure
Synonyms	1-Methoxy-3-indoleacetonitrile
IUPAC Name	2-(1-methoxyindol-3-yl)acetonitrile
Molecular Weight	186.21
Molecular Formula	C11H10N2O
Canonical SMILES	CON1C=C(C2=CC=CC=C21)CC#N
InChI	InChI=1S/C11H10N2O/c1-14-13-8-9(6-7-12)10-4-2-3-5-11(10)13/h2-5,8H,6H2,1H3
InChI Key	LIJIPBYXIXTNLE-UHFFFAOYSA-N
Purity	98%
Appearance	Solid
Complexity	245
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	186.079312947
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	186.079312947
PhysicalState	Oil
Rotatable Bond Count	2
Topological Polar Surface Area	38 Ų

Custom Q&A

What is the chemical name for the compound 1-Methoxyindoleacetonitrile?

The chemical name for the compound is 1-Methoxy-1H-indole-3-acetonitrile.

What are some synonyms for 1-Methoxyindoleacetonitrile?

Some synonyms include Caulilexin C, Caulilexine C, and 1-Methoxy-3-indoleacetonitrile.

What is the molecular formula of 1-Methoxyindoleacetonitrile?

The molecular formula is C11H10N2O.

What is the molecular weight of 1-Methoxyindoleacetonitrile?

The molecular weight is 186.21 g/mol.

How should 1-Methoxyindoleacetonitrile be stored?

It should be stored at -20°C, sealed storage, away from moisture and light.

What is the biological activity of Caulilexin C?

Caulilexin C is a phytoalexin from cruciferous plants with antifungal activity.

What effect does Caulilexin C have on Rhizoctonia solani in vitro?

It causes complete growth inhibition of Rhizoctonia solani at 0.5 mM.

How does Caulilexin C compare to arvelexin in terms of antifungal activity?

It appears to be slightly more antifungal than arvelexin.

What is the target of 1-Methoxyindoleacetonitrile's antifungal activity?

The target is antifungal, specifically against Rhizoctonia solani and Leptosphaeria maculans.

What is another name for Caulilexin C?

Another name for Caulilexin C is Caulilexine C.

※ Please kindly note that our products are for research use only.