1-Methoxymethyl-beta-carboline

Catalog Number	ACM55854609
CAS Number	55854-60-9
Molecular Weight	212.25
InChI	InChI=1S/C13H12N2O/c1-16-8-12-13-10(6-7-14-12)9-4-2-3-5-11(9)15-13/h2-7,15H,8H2,1H3
InChI Key	OELXEULZDKMFCS-UHFFFAOYSA-N
Purity	95%+
Complexity	246
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	212.094963011
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Monoisotopic Mass	212.094963011
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	37.9 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 55854-60-9?

The chemical name of the compound is 1-Methoxymethyl-beta-carboline.

What is the synonym of 1-Methoxymethyl-beta-carboline?

The synonym of 1-Methoxymethyl-beta-carboline is 9H-Pyrido[3,4-b]indole, 1-(methoxymethyl)-.

What is the molecular formula of 1-Methoxymethyl-beta-carboline?

The molecular formula of 1-Methoxymethyl-beta-carboline is C13H12N2O.

What is the molecular weight of 1-Methoxymethyl-beta-carboline?

The molecular weight of 1-Methoxymethyl-beta-carboline is 212.25.

What is the CAS number of 1-Methoxymethyl-beta-carboline?

The CAS number of 1-Methoxymethyl-beta-carboline is 55854-60-9.

What is the significance of the methoxymethyl group in the compound?

The methoxymethyl group is a substituent that contains both a methoxy and a methyl group, which can influence the compound's properties and reactivity.

How is 1-Methoxymethyl-beta-carboline typically synthesized in the laboratory?

1-Methoxymethyl-beta-carboline is typically synthesized by a series of chemical reactions involving indole and methanol.

※ Please kindly note that our products are for research use only.