1-Methyl-2-pentyl-4(1H)-quinolinone

Catalog Number	ACM22048982
CAS Number	22048-98-2
Structure
Synonyms	1-Methyl-2-pentylquinolin-4(1H)-one
Molecular Weight	229.32
InChI	InChI=1S/C15H19NO/c1-3-4-5-8-12-11-15(17)13-9-6-7-10-14(13)16(12)2/h6-7,9-11H,3-5,8H2,1-2H3
InChI Key	CHULATXGEVFYAJ-UHFFFAOYSA-N
Purity	95%+
Complexity	308
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	229.14666423
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	229.14666423
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	20.3 Ų

Custom Q&A

What is the chemical name of the compound 1-Methyl-2-pentyl-4(1H)-quiline?

The chemical name of the compound is 1-Methyl-2-pentyl-4(1H)-quiline.

What are some synonyms for 1-Methyl-2-pentyl-4(1H)-quiline?

Some synonyms for 1-Methyl-2-pentyl-4(1H)-quiline are 1-Methyl-2-pentyl-4(1H)-quinolinone, 1-Methyl-2-pentylquinolin-4(1H)-one, and 1-Methyl-2-pentyl-4-(1H)-quinolone.

What is the CAS number of 1-Methyl-2-pentyl-4(1H)-quiline?

The CAS number of 1-Methyl-2-pentyl-4(1H)-quiline is 22048-98-2.

What is the molecular formula of 1-Methyl-2-pentyl-4(1H)-quiline?

The molecular formula of 1-Methyl-2-pentyl-4(1H)-quiline is C15H19NO.

What is the molecular weight of 1-Methyl-2-pentyl-4(1H)-quiline?

The molecular weight of 1-Methyl-2-pentyl-4(1H)-quiline is 229.32.

What is the predicted boiling point of 1-Methyl-2-pentyl-4(1H)-quiline?

The predicted boiling point of 1-Methyl-2-pentyl-4(1H)-quiline is 332.1±42.0°C.

In what temperature range is it recommended to store 1-Methyl-2-pentyl-4(1H)-quiline?

It is recommended to store 1-Methyl-2-pentyl-4(1H)-quiline at 2-8°C.

In which solvents is 1-Methyl-2-pentyl-4(1H)-quiline soluble?

1-Methyl-2-pentyl-4(1H)-quiline is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of 1-Methyl-2-pentyl-4(1H)-quiline?

The form of 1-Methyl-2-pentyl-4(1H)-quiline is powder.

What is the predicted pKa of 1-Methyl-2-pentyl-4(1H)-quiline?

The predicted pKa of 1-Methyl-2-pentyl-4(1H)-quiline is 2.69±0.70.

※ Please kindly note that our products are for research use only.