1-Methyl-L-tryptophan

Catalog Number	ACM21339559
CAS Number	21339-55-9
Structure
Synonyms	(2S)-2-Amino-3-(1-methylindol-3-yl)propanoic acid
Molecular Weight	218.25
InChI	InChI=1S/C12H14N2O2/c1-14-7-8(6-10(13)12(15)16)9-4-2-3-5-11(9)14/h2-5,7,10H,6,13H2,1H3,(H,15,16)/t10-/m0/s1
InChI Key	ZADWXFSZEAPBJS-JTQLQIEISA-N
Melting Point	>300 °C
Purity	95%+
Complexity	270
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	218.105527694
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Isomeric SMILES	CN1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)N
Monoisotopic Mass	218.105527694
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	68.2 Ų

Custom Q&A

What is the chemical formula for 1-Methyl-L-tryptophan?

The chemical formula for 1-Methyl-L-tryptophan is C12H14N2O2.

What is the molecular weight of 1-Methyl-L-tryptophan?

The molecular weight of 1-Methyl-L-tryptophan is 218.25.

What is the melting point of 1-Methyl-L-tryptophan?

The melting point of 1-Methyl-L-tryptophan is greater than 300 °C.

How does 1-Methyl-L-tryptophan appear in terms of color?

1-Methyl-L-tryptophan appears as off-white to pale beige in color.

How is 1-Methyl-L-tryptophan stored?

1-Methyl-L-tryptophan is stored in a dark place, in an inert atmosphere, at room temperature.

What is the solubility of 1-Methyl-L-tryptophan?

1-Methyl-L-tryptophan is slightly soluble in aqueous acid, aqueous base, and DMSO.

What is the usage of 1-Methyl-L-tryptophan?

1-Methyl-L-tryptophan can be used in the preparation of ligands for catalysis and in the synthesis of drug delivery systems.

What are the safety codes associated with 1-Methyl-L-tryptophan?

The hazard code for 1-Methyl-L-tryptophan is Xn and the risk statements are 20/21/22.

What is the optical activity of 1-Methyl-L-tryptophan?

The optical activity of 1-Methyl-L-tryptophan is [α]24/D 8.0°.

What is the chemical classification of 1-Methyl-L-tryptophan?

1-Methyl-L-tryptophan is classified as an indolyl carboxylic acid.

※ Please kindly note that our products are for research use only.