10-Hydroxyscandine

Catalog Number	ACM119188475
CAS Number	119188-47-5
Molecular Weight	366.4
InChI	InChI=1S/C21H22N2O4/c1-3-19-7-4-9-23-10-8-20(16(19)23)14-11-13(24)5-6-15(14)22-17(25)21(20,12-19)18(26)27-2/h3-7,11,16,24H,1,8-10,12H2,2H3,(H,22,25)/t16-,19-,20+,21+/m0/s1
InChI Key	LGEFXJCPQAMQOD-VRXWPRPYSA-N
Purity	95%+
Complexity	751
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	366.15795719
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	COC(=O)[C@]12C[C@@]3(C=CCN4[C@@H]3[C@@]1(CC4)C5=C(C=CC(=C5)O)NC2=O)C=C
Monoisotopic Mass	366.15795719
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	78.9 Ų

Custom Q&A

What is the chemical name of 10-Hydroxyscandine?

The chemical name of 10-Hydroxyscandine is 10H-Indolizino[1',8':2,3,4]cyclopenta[1,2-c]quinoline-6a(7H)-carboxylic acid, 7a-ethenyl-5,6,7a,11a,12,13-hexahydro-2-hydroxy-6-oxo-, methyl ester, (6aR,7aS,11aS,13aS)-.

What is the CAS number of 10-Hydroxyscandine?

The CAS number of 10-Hydroxyscandine is 119188-47-5.

What is the molecular formula of 10-Hydroxyscandine?

The molecular formula of 10-Hydroxyscandine is C21H22N2O4.

What is the molecular weight of 10-Hydroxyscandine?

The molecular weight of 10-Hydroxyscandine is 366.41.

What is the boiling point of 10-Hydroxyscandine?

The boiling point of 10-Hydroxyscandine is predicted to be 577.1±50.0 °C.

What is the density of 10-Hydroxyscandine?

The density of 10-Hydroxyscandine is predicted to be 1.40±0.1 g/cm3.

What is the pka value of 10-Hydroxyscandine?

The pka value of 10-Hydroxyscandine is predicted to be 9.86±0.60.

What are some synonyms of 10-Hydroxyscandine?

Some synonyms of 10-Hydroxyscandine are 10-Hydroxyscandine and methyl ester.

What are the stereochemistry characteristics of 10-Hydroxyscandine?

The stereochemistry characteristics of 10-Hydroxyscandine are (6aR,7aS,11aS,13aS)-.

※ Please kindly note that our products are for research use only.