11-Hydroxycanthin-6-one

Catalog Number	ACM75969834
CAS Number	75969-83-4
Molecular Weight	236.22
InChI	InChI=1S/C14H8N2O2/c17-11-3-1-2-10-13(11)8-6-7-15-9-4-5-12(18)16(10)14(8)9/h1-7,15H
InChI Key	IZNXKZBIIFOWPU-UHFFFAOYSA-N
Melting Point	327-329 °C
Purity	95%+
Complexity	699
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	236.058577502
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	236.058577502
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	49.4 Ų

Custom Q&A

What is the chemical formula for 11-Hydroxycanthin-6-one?

The chemical formula for 11-Hydroxycanthin-6-one is C14H8N2O2.

What is the molecular weight of 11-Hydroxycanthin-6-one?

The molecular weight of 11-Hydroxycanthin-6-one is 236.23.

What is the CAS number for 11-Hydroxycanthin-6-one?

The CAS number for 11-Hydroxycanthin-6-one is 75969-83-4.

What is the melting point of 11-Hydroxycanthin-6-one?

The melting point of 11-Hydroxycanthin-6-one is 327-329 °C.

What is the boiling point of 11-Hydroxycanthin-6-one predicted to be?

The boiling point of 11-Hydroxycanthin-6-one is predicted to be 410.1±45.0 °C.

What is the density of 11-Hydroxycanthin-6-one predicted to be?

The density of 11-Hydroxycanthin-6-one is predicted to be 1.53±0.1 g/cm3.

What is the pKa value of 11-Hydroxycanthin-6-one predicted to be?

The pKa value of 11-Hydroxycanthin-6-one is predicted to be 8.62±0.20.

How is 11-Hydroxycanthin-6-one defined in ChEBI?

11-Hydroxycanthin-6-one is defined in ChEBI as Amalorin, an organic heterotetracyclic compound and an alkaloid.

What are some synonyms for 11-Hydroxycanthin-6-one?

Some synonyms for 11-Hydroxycanthin-6-one include CANTHIN-6-ONE, 11-HYDROXY- and 6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 11-hydroxy-.

※ Please kindly note that our products are for research use only.