11-Hydroxygelsenicine

Catalog Number	ACM1195760689
CAS Number	1195760-68-9
IUPAC Name	(1S,2S,7R)-6-ethyl-6'-hydroxy-1'-methoxyspiro[10-oxa-5-azatricyclo[5.3.1.04,8]undec-5-ene-2,3'-indole]-2'-one
Molecular Weight	342.39
Molecular Formula	C19H22N2O4
Canonical SMILES	CCC1=NC2C[C@@]3([C@@H]4C[C@@H]1C2CO4)C5=C(C=C(C=C5)O)N(C3=O)OC
InChI	InChI=1S/C19H22N2O4/c1-3-14-11-7-17-19(8-15(20-14)12(11)9-25-17)13-5-4-10(22)6-16(13)21(24-2)18(19)23/h4-6,11-12,15,17,22H,3,7-9H2,1-2H3/t11-,12?,15?,17+,19+/m1/s1
InChI Key	ZXUAITOHPKQHGN-NKZRWYIWSA-N
Boiling Point	525.4±60.0 °C
Melting Point	223-225 °C
Purity	98%
Density	1.53±0.1 g/ml
Appearance	Solid
Complexity	623
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	342.15795719
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Monoisotopic Mass	342.15795719
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	71.4 Ų

Custom Q&A

What is the chemical formula of 11-Hydroxygelsenicine?

The chemical formula of 11-Hydroxygelsenicine is C19H22N2O4.

What is the molecular weight of 11-Hydroxygelsenicine?

The molecular weight of 11-Hydroxygelsenicine is 342.39.

What is the melting point of 11-Hydroxygelsenicine?

The melting point of 11-Hydroxygelsenicine is 223.0-225.0 °C.

In what solvents is 11-Hydroxygelsenicine soluble?

11-Hydroxygelsenicine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted boiling point of 11-Hydroxygelsenicine?

The predicted boiling point of 11-Hydroxygelsenicine is 525.4±60.0 °C.

What is the density of 11-Hydroxygelsenicine?

The density of 11-Hydroxygelsenicine is 1.53±0.1 g/cm3.

What is the pKa value of 11-Hydrogelsenicine?

The pKa value of 11-Hydrogelsenicine is 8.84±0.40.

What are some common uses of 11-Hydroxygelsenicine?

11-Hydroxygelsenicine can be used to separate gelsemium alkaloid monomer from gelsemium alkaloid using high-speed countercurrent chromatography and can be applied to various artificial antigen applications.

What is the chemical structure of 11-Hydroxygelsenicine?

The chemical structure of 11-Hydroxygelsenicine is Spiro[3H-indole-3,7'(6'H)-[3,6]methano[3H]oxepino[4,3-b]pyrrol]-2(1H)-one, 2'-ethyl-3'a,4',8',8'a-tetrahydro-6-hydroxy-1-methoxy-, (3S,3'R,3'aS,6'R,8'aS)-.

How can 11-Hydroxygelsenicine be used in chromatography?

11-Hydroxygelsenicine can be used in high-speed countercurrent chromatography with preparative liquid chromatography to separate gelsemium alkaloid monomers.

※ Please kindly note that our products are for research use only.