11-Hydroxyhumantenine

Catalog Number	ACM122590049
CAS Number	122590-04-9
Synonyms	N-Methyl-11-hydroxyrankinidine
IUPAC Name	(7Z)-7-ethylidene-6'-hydroxy-1'-methoxy-5-methylspiro[11-oxa-5-azatricyclo[6.3.1.04,9]dodecane-2,3'-indole]-2'-one
Molecular Weight	370.44
Molecular Formula	C21H26N2O4
Canonical SMILES	C/C=C/1\CN(C2CC3(C4CC1C2CO4)C5=C(C=C(C=C5)O)N(C3=O)OC)C
InChI	InChI=1S/C21H26N2O4/c1-4-12-10-22(2)18-9-21(19-8-14(12)15(18)11-27-19)16-6-5-13(24)7-17(16)23(26-3)20(21)25/h4-7,14-15,18-19,24H,8-11H2,1-3H3/b12-4+
InChI Key	VYZFRSLZSBLYIC-UUILKARUSA-N
Purity	98%
Appearance	Solid
Complexity	667
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	370.18925731
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C/1\CN(C2CC3(C4CC1C2CO4)C5=C(C=C(C=C5)O)N(C3=O)OC)C
Monoisotopic Mass	370.18925731
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	62.2 Ų

Custom Q&A

What is the product name of this chemical compound?

The product name of this chemical compound is 11-HydroxyhuMantenine.

What are some synonyms for 11-HydroxyhuMantenine?

Some synonyms for 11-HydroxyhuMantenine are N-Methyl-11-hydroxyrankinidine and Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-6-hydroxy-1-methoxy-1'-methyl-, (3S,3'Z,4'R,4'aS,7'R,9'aS)-.

What is the CAS number of 11-HydroxyhuMantenine?

The CAS number of 11-HydroxyhuMantenine is 122590-04-9.

What is the molecular formula of 11-HydroxyhuMantenine?

The molecular formula of 11-HydroxyhuMantenine is C21H26N2O4.

What is the molecular weight of 11-HydroxyhuMantenine?

The molecular weight of 11-HydroxyhuMantenine is 370.44.

In what forms is 11-HydroxyhuMantenine soluble?

11-HydroxyhuMantenine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the physical form of 11-HydroxyhuMantenine?

The physical form of 11-HydroxyhuMantenine is a powder.

What are some common solvents in which 11-HydroxyhuMantenine can dissolve?

Some common solvents in which 11-HydroxyhuMantenine can dissolve are Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

What is the chemical structure of 11-HydroxyhuMantenine?

The chemical structure of 11-HydroxyhuMantenine is Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-6-hydroxy-1-methoxy-1'-methyl-, (3S,3'Z,4'R,4'aS,7'R,9'aS)-.

What is the appearance of 11-HydroxyhuMantenine?

11-HydroxyhuMantenine appears as a fine powder.

※ Please kindly note that our products are for research use only.