11-Hydroxyrankinidine

Catalog Number	ACM122590038
CAS Number	122590-03-8
Synonyms	Nb-Demethyl-11-hydroxyhumantenine
IUPAC Name	(7Z)-7-ethylidene-6'-hydroxy-1'-methoxyspiro[11-oxa-5-azatricyclo[6.3.1.04,9]dodecane-2,3'-indole]-2'-one
Molecular Weight	356.42
Molecular Formula	C20H24N2O4
Canonical SMILES	C/C=C/1\CNC2CC3(C4CC1C2CO4)C5=C(C=C(C=C5)O)N(C3=O)OC
InChI	InChI=1S/C20H24N2O4/c1-3-11-9-21-16-8-20(18-7-13(11)14(16)10-26-18)15-5-4-12(23)6-17(15)22(25-2)19(20)24/h3-6,13-14,16,18,21,23H,7-10H2,1-2H3/b11-3+
InChI Key	FALAMCOLIJTCTR-QDEBKDIKSA-N
Purity	98%
Appearance	Solid
Complexity	637
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	356.17360725
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C/1\CNC2CC3(C4CC1C2CO4)C5=C(C=C(C=C5)O)N(C3=O)OC
Monoisotopic Mass	356.17360725
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	71 Ų

Custom Q&A

What is the chemical formula of 11-Hydroxyrankinidine?

The chemical formula of 11-Hydroxyrankinidine is C20H24N2O4.

What is the molecular weight of 11-Hydroxyrankinidine?

The molecular weight of 11-Hydroxyrankinidine is 356.42.

In what form does 11-Hydroxyrankinidine exist?

11-Hydroxyrankinidine exists in the form of powder.

What are some solvents in which 11-Hydroxyrankinidine is soluble?

11-Hydroxyrankinidine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the CAS number of 11-Hydroxyrankinidine?

The CAS number of 11-Hydroxyrankinidine is 122590-03-8.

What are the synonyms of 11-Hydroxyrankinidine?

The synonyms of 11-Hydroxyrankinidine are Nb-Demethyl-11-hydroxyhumantenine and Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-6-hydroxy-1-methoxy-, (3S,3'Z,4'R,4'aS,7'R,9'aS)-.

What is the molecular formula of 11-Hydroxyrankinidine?

The molecular formula of 11-Hydroxyrankinidine is C20H24N2O4.

What is the physical state of 11-Hydroxyrankinidine?

The physical state of 11-Hydroxyrankinidine is a powder.

Which specific solvents can be used to dissolve 11-Hydroxyrankinidine?

11-Hydroxyrankinidine can be dissolved in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

What are the basic information and properties of 11-Hydroxyrankinidine?

The basic information of 11-Hydroxyrankinidine includes its chemical formula, molecular weight, CAS number, and synonyms. Its properties include solubility in various solvents and existence in the form of powder.

※ Please kindly note that our products are for research use only.