13-Methoxyibogamine

Catalog Number	ACM83943
CAS Number	83-94-3
Structure
Synonyms	Tabernanthine
Molecular Weight	310.4
InChI	InChI=1S/C20H26N2O/c1-3-13-8-12-9-17-19-16(6-7-22(11-12)20(13)17)15-5-4-14(23-2)10-18(15)21-19/h4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3/t12-,13+,17+,20+/m1/s1
InChI Key	UCIDWKVIQZIKEK-CFDPKNGZSA-N
Melting Point	213.5-215 °C
Purity	95%+
Complexity	455
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	310.204513457
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@H]1C[C@@H]2C[C@@H]3[C@H]1N(C2)CCC4=C3NC5=C4C=CC(=C5)OC
Monoisotopic Mass	310.204513457
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	28.3 Ų

Custom Q&A

What is the chemical formula of tabernanthine?

The chemical formula of tabernanthine is C20H26N2O.

What is the molecular weight of tabernanthine?

The molecular weight of tabernanthine is 310.43.

What is the melting point of tabernanthine?

The melting point of tabernanthine is 213.5-215°C.

How is tabernanthine purified?

Tabernanthine is best purified by sublimation.

What is the boiling point of tabernanthine?

The boiling point of tabernanthine is 160°C.

In what plants does tabernanthine occur?

Tabernanthine occurs in Tabernanthe iboga Bail and Stem madenia donnell-smithii R. E. Woodson.

What are the pharmacological effects of tabernanthine when injected intravenously into dogs?

Tabernanthine is hypotensive, reduces reflex hypertension, decreases respiration rate and amplitude, and increases hypertension produced by adrenaline.

What is the optical rotation of tabernanthine hydrochloride in MeOH?

The optical rotation of tabernanthine hydrochloride in MeOH is [α]25.5D -66°.

How is tabernanthine hydrochloride obtained?

Tabernanthine hydrochloride forms colorless crystals from boiling water.

What is one of the absorption maxima in the ultraviolet spectrum of tabernanthine?

One of the absorption maxima in the ultraviolet spectrum of tabernanthine is at 271 nm.

※ Please kindly note that our products are for research use only.