(15E)-12β-Acetoxy-18-norsenecionan-11,16-dione

Catalog Number	ACM11051948
CAS Number	11051-94-8
Synonyms	Crotastriatine
Molecular Weight	363.4
InChI	InChI=1S/C19H25NO6/c1-4-13-9-11(2)17(25-12(3)21)19(23)24-10-14-5-7-20-8-6-15(16(14)20)26-18(13)22/h4-5,11,15-17H,6-10H2,1-3H3/b13-4+/t11-,15-,16-,17-/m1/s1
InChI Key	POAACKCBTJLFMK-GFXIYLJVSA-N
Melting Point	133 °C
Purity	95%+
Complexity	667
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	363.16818752
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	C/C=C/1\C[C@H]([C@H](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC1=O)OC(=O)C)C
Monoisotopic Mass	363.16818752
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	82.1 Ų

Custom Q&A

What is the chemical name of (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione?

The chemical name is (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione.

What are the synonyms for (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione?

The synonyms are Crotastriatine and (12beta,15E)-12-(Acetyloxy)-18-norsenecionan-11,16-dione, among others.

What is the CAS number for (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione?

The CAS number is 11051-94-8.

What is the molecular formula of (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione?

The molecular formula is C19H25NO6.

What is the molecular weight of (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione?

The molecular weight is 363.4.

What is the melting point of (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione?

The melting point is 133 °C.

What is the boiling point of (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione?

The boiling point is predicted to be 581.9±50.0 °C.

What is the density of (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione?

The density is predicted to be 1.25±0.1 g/cm3.

What is the pka value of (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione?

The pka value is predicted to be 5.71±0.60.

In what form is (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione predicted to be at room temperature?

At room temperature, (15E)-12β-Acetoxy-18-norsenecionan-11,16-dione is predicted to be in solid form.

※ Please kindly note that our products are for research use only.