16,17-Dihydroapovincamine

Catalog Number	ACM57130300
CAS Number	57130-30-0
Synonyms	Vinpocetine impurity 8
Molecular Weight	338.4
InChI	InChI=1S/C21H26N2O2/c1-3-21-10-6-11-22-12-9-15-14-7-4-5-8-16(14)23(18(15)19(21)22)17(13-21)20(24)25-2/h4-5,7-8,17,19H,3,6,9-13H2,1-2H3/t17?,19-,21+/m1/s1
InChI Key	BOAFIDYFQWIRTC-FMVHKLRBSA-N
Purity	95%+
Complexity	552
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	338.199428076
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	CC[C@@]12CCCN3[C@@H]1C4=C(CC3)C5=CC=CC=C5N4C(C2)C(=O)OC
Monoisotopic Mass	338.199428076
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	34.5 Ų

Custom Q&A

What is the chemical name of 16,17-Dihydroapovincamine?

Eburnamenine-14-carboxylic acid, 14,15-dihydro-, methyl ester, (3α,16α)

What are the synonyms of 16,17-Dihydroapovincamine?

Vinpocetine Impurity 8, Vinpocetine Impurity 15 HCl, Vinpocetine-22

What is the CAS number of 16,17-Dihydroapovincamine?

57130-30-0

What is the molecular formula of 16,17-Dihydroapovincamine?

C21H26N2O2

What is the molecular weight of 16,17-Dihydroapovincamine?

338.44

What is the main use of 16,17-Dihydroapovincamine?

It is used as an impurity of Vincamine, often used as a nootropic agent to combat the effects of aging.

What is Vincamine and what is its function?

Vincamine is a peripheral vasodilator that increases blood flow to the brain.

How is 16,17-Dihydroapovincamine commonly used in combination with other substances?

It is commonly used in conjunction with other nootropics, such as piracetam, for a variety of purposes.

What are some potential benefits of using 16,17-Dihydroapovincamine as a nootropic agent?

It may help combat the effects of aging on cognitive function and enhance brain blood flow.

What is the chemical structure of 16,17-Dihydroapovincamine?

The chemical structure includes a eburnamenine and carboxylic acid groups.

※ Please kindly note that our products are for research use only.