16-Hydroxytabersonine

Catalog Number	ACM22149286
CAS Number	22149-28-6
Synonyms	11-Hydroxytabersonine
Molecular Weight	352.4
InChI	InChI=1S/C21H24N2O3/c1-3-20-7-4-9-23-10-8-21(19(20)23)15-6-5-13(24)11-16(15)22-17(21)14(12-20)18(25)26-2/h4-7,11,19,22,24H,3,8-10,12H2,1-2H3/t19-,20-,21-/m0/s1
InChI Key	FXUFRJQCBVSCRZ-ACRUOGEOSA-N
Purity	95%+
Complexity	701
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	352.17869263
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC[C@]12CC(=C3[C@@]4([C@H]1N(CC4)CC=C2)C5=C(N3)C=C(C=C5)O)C(=O)OC
Monoisotopic Mass	352.17869263
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	61.8 Ų

Custom Q&A

What is the molecular formula of 11-Hydroxytabersonine?

The molecular formula of 11-Hydroxytabersonine is C21H24N2O3.

What is the molecular weight of 11-Hydroxytabersonine?

The molecular weight of 11-Hydroxytabersonine is 352.43.

What is the melting point of 11-Hydroxytabersonine?

The melting point of 11-Hydroxytabersonine is 176 °C.

What is the boiling point of 11-Hydroxytabersonine?

The boiling point of 11-Hydroxytabersonine is predicted to be 532.1±50.0 °C.

What is the density of 11-Hydroxytabersonine?

The density of 11-Hydroxytabersonine is predicted to be 1.34±0.1 g/cm3.

What is the pka value of 11-Hydroxytabersonine?

The pka value of 11-Hydroxytabersonine is predicted to be 10.23±0.60.

What is the chemical property of 11-Hydroxytabersonine?

11-Hydroxytabersonine is a monoterpenoid indole alkaloid, a methyl ester, and an organic heteropentacyclic compound.

How is 16-hydroxytabersonine functionally related?

16-hydroxytabersonine is functionally related to a tabersonine.

What is 16-hydroxytabersonine a conjugate base of?

16-hydroxytabersonine is a conjugate base of a 16-hydroxytabersoninium.

What are some synonyms for 11-Hydroxytabersonine?

Some synonyms for 11-Hydroxytabersonine are VincamineImpurity21 and Methyl(5α,12β,19α)-16-hydroxy-2,3,6,7-tetradehydroaspidospermidine-3-carboxylate.

※ Please kindly note that our products are for research use only.