16-Methoxystrychnine

Catalog Number	ACM5096720
CAS Number	5096-72-0
Synonyms	16-Methoxystrychnidin-10-one
Molecular Weight	364.4
InChI	InChI=1S/C22H24N2O3/c1-26-22-11-14-13-6-9-27-17-10-18(25)24-16-5-3-2-4-15(16)21(22,20(24)19(14)17)7-8-23(22)12-13/h2-6,14,17,19-20H,7-12H2,1H3/t14-,17-,19-,20-,21-,22+/m0/s1
InChI Key	BMDMNLBIKSAWCI-FCGMOTLLSA-N
Melting Point	214-218 °C
Purity	90%+
Complexity	752
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	364.17869263
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Isomeric SMILES	CO[C@]12C[C@@H]3[C@H]4[C@@H]5CC(=O)N6[C@@H]4[C@]1(CCN2CC3=CCO5)C7=CC=CC=C76
Monoisotopic Mass	364.17869263
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	42 Ų

Custom Q&A

What is the chemical name of the product?

The chemical name of the product is 16-Methoxystrychnidin-10-one.

What are some synonyms for 16-Methoxystrychnidin-10-one?

Some synonyms for 16-Methoxystrychnidin-10-one are 16-Methoxystrychinine, NSC 118070, and Strychnidin-10-one, 16-methoxy.

What is the CAS number of 16-Methoxystrychnidin-10-one?

The CAS number of 16-Methoxystrychnidin-10-one is 5096-72-0.

What is the molecular formula of 16-Methoxystrychnidin-10-one?

The molecular formula of 16-Methoxystrychnidin-10-one is C22H24N2O3.

What is the molecular weight of 16-Methoxystrychnidin-10-one?

The molecular weight of 16-Methoxystrychnidin-10-one is 364.44.

What is the melting point of 16-Methoxystrychnidin-10-one?

The melting point of 16-Methoxystrychnidin-10-one is 214-218 °C.

What is the predicted boiling point of 16-Methoxystrychnidin-10-one?

The predicted boiling point of 16-Methoxystrychnidin-10-one is 567.1±50.0 °C.

What is the predicted density of 16-Methoxystrychnidin-10-one?

The predicted density of 16-Methoxystrychnidin-10-one is 1.41±0.1 g/cm3.

What is the predicted pKa of 16-Methoxystrychnidin-10-one?

The predicted pKa of 16-Methoxystrychnidin-10-one is 6.18±0.40.

How do the properties of 16-Methoxystrychnidin-10-one make it useful in research or industry?

The specific chemical properties, such as melting point, boiling point, density, and pKa, of 16-Methoxystrychnidin-10-one can be used to determine its potential applications in research or industry, such as in pharmaceuticals or materials science.

※ Please kindly note that our products are for research use only.