16-Methoxytabersonine

Catalog Number	ACM27773393
CAS Number	27773-39-3
Structure
Synonyms	Ervamycine
Molecular Weight	366.5
InChI	InChI=1S/C22H26N2O3/c1-4-21-8-5-10-24-11-9-22(20(21)24)16-7-6-14(26-2)12-17(16)23-18(22)15(13-21)19(25)27-3/h5-8,12,20,23H,4,9-11,13H2,1-3H3/t20-,21-,22-/m0/s1
InChI Key	AEXBRBWRPNGGEZ-FKBYEOEOSA-N
Purity	95%+
Complexity	716
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	366.1943427
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@]12CC(=C3[C@@]4([C@H]1N(CC4)CC=C2)C5=C(N3)C=C(C=C5)OC)C(=O)OC
Monoisotopic Mass	366.1943427
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	50.8 Ų

Custom Q&A

What is the chemical formula of Ervamycine?

The chemical formula of Ervamycine is C22H26N2O3.

What is the CAS number for 16-Methoxytabersonine?

The CAS number for 16-Methoxytabersonine is 27773-39-3.

What is the molecular weight of 16-Methoxytabersonine?

The molecular weight of 16-Methoxytabersonine is 366.46 g/mol.

What is the boiling point of Ervamycine?

The predicted boiling point of Ervamycine is 514.6±50.0 °C.

How is 16-Methoxytabersonine used in synthesis?

16-Methoxytabersonine can be hydrogenated over PtO2 to give the 6:7-dihydro derivative, or heated with 5N-HCl to hydrolyze and decarboxylate to furnish 16-methoxy-1,2-dehydro-aspidospermidine.

What is the melting point of 16-Methoxytabersonine?

The crystalline hydrochloride of 16-Methoxytabersonine has a melting point of 184-6°C (dec.).

How is 16-Methoxytabersonine related to tabersonine?

16-Methoxytabersonine is the 16-methoxy derivative of tabersonine.

What is the specific rotation of the free base form of 16-Methoxytabersonine?

The free base form of 16-Methoxytabersonine has a specific rotation of [α]23D -310° ± 2°.

How is 16-Methoxytabersonine classified in terms of compound type?

16-Methoxytabersonine is classified as a monoterpenoid indole alkaloid, an organic heteropentacyclic compound, a methyl ester, and a tertiary amino compound.

※ Please kindly note that our products are for research use only.