19(S)-Hydroxyconopharyngine

Catalog Number	ACM16790935
CAS Number	16790-93-5
Synonyms	20S-Hydroxyconopharyngine
Molecular Weight	414.5
InChI	InChI=1S/C23H30N2O5/c1-12(26)15-7-13-10-23(22(27)30-4)20-14(5-6-25(11-13)21(15)23)16-8-18(28-2)19(29-3)9-17(16)24-20/h8-9,12-13,15,21,24,26H,5-7,10-11H2,1-4H3/t12-,13+,15+,21-,23+/m0/s1
InChI Key	RCDVEJINCXVEQG-UNJQAPKOSA-N
Purity	95%+
Complexity	676
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	414.21547206
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@@H]([C@H]1C[C@@H]2C[C@@]3([C@H]1N(C2)CCC4=C3NC5=CC(=C(C=C45)OC)OC)C(=O)OC)O
Monoisotopic Mass	414.21547206
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	84 Ų

Custom Q&A

What is the chemical name of 20S-Hydroxyconopharyngine?

Ibogamine-18-carboxylic acid, 20-hydroxy-12,13-dimethoxy-, methyl ester, (20S)-

What is the CAS number of 20S-Hydroxyconopharyngine?

16790-93-5

What is the molecular formula of 20S-Hydroxyconopharyngine?

C23H30N2O5

What is the molecular weight of 20S-Hydroxyconopharyngine?

414.5 g/mol

What is the predicted boiling point of 20S-Hydroxyconopharyngine?

560.3 ± 50.0 °C

What is the predicted density of 20S-Hydroxyconopharyngine?

1.32 ± 0.1 g/cm3

What is the predicted pKa value of 20S-Hydroxyconopharyngine?

14.93 ± 0.20

What are some synonyms for 20S-Hydroxyconopharyngine?

20-Hydroxyconopharyngine, 19(S)-Hydroxyconopharyngine, Ibogamine-18-carboxylic acid

How is 20S-Hydroxyconopharyngine predicted to behave at its boiling point?

It is predicted to vaporize.

How does the density of 20S-Hydroxyconopharyngine compare to water?

It is denser than water.

※ Please kindly note that our products are for research use only.