(1R,5R,6S)-Rel-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-one

Catalog Number	ACM5932536-1
CAS Number	5932-53-6
Structure
Synonyms	6-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-one
Molecular Weight	155.19
InChI	InChI=1S/C8H13NO2/c1-9-5-2-6(10)4-7(9)8(11)3-5/h5,7-8,11H,2-4H2,1H3/t5-,7+,8-/m0/s1
InChI Key	UOHSTKWPZWFYTF-ARDNSNSESA-N
Melting Point	120-121 °C
Purity	98%+
Complexity	193
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	155.094628657
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1[C@@H]2C[C@@H]([C@H]1CC(=O)C2)O
Monoisotopic Mass	155.094628657
PhysicalState	Solid
Rotatable Bond Count	0
Topological Polar Surface Area	40.5 Ų

Custom Q&A

What is the chemical name of the compound (+/-)-exo-6-Hydroxytropinone?

The chemical name is 6-Hydroxy-8-methyl-8-azabiscyclo[3.2.1]octan-3-one.

What is the molecular formula of (+/-)-exo-6-Hydroxytropinone?

The molecular formula is C8H13NO2.

What is the molecular weight of (+/-)-exo-6-Hydroxytropinone?

The molecular weight is 155.19 g/mol.

What is the melting point of (+/-)-exo-6-Hydroxytropinone?

The melting point is 120-121°C.

What is the boiling point of (+/-)-exo-6-Hydroxytropinone?

The boiling point is estimated to be 279°C.

In what type of solvents is (+/-)-exo-6-Hydroxytropinone slightly soluble?

It is slightly soluble in chloroform, DMSO, and methanol.

What is the potential health risk associated with (+/-)-exo-6-Hydroxytropinone?

Risk Statements: 23/25

How is (+/-)-exo-6-Hydroxytropinone commonly used in chemical reactions?

It is used as a reagent for the preparation of racemic scopolamine.

What is the color of (+/-)-exo-6-Hydroxytropinone?

The color ranges from light orange to brown.

What is the storage recommendation for (+/-)-exo-6-Hydroxytropinone?

It should be sealed in a dry environment at room temperature.

※ Please kindly note that our products are for research use only.