2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one

2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one

Inquiry
Catalog Number ACM6064853-1
CAS Number 6064-85-3
Structure
Synonyms 7-Methyl-2,3-dihydro-1H-pyrrolizin-1-one
Molecular Weight 135.16
InChI InChI=1S/C8H9NO/c1-6-2-4-9-5-3-7(10)8(6)9/h2,4H,3,5H2,1H3
InChI Key ZWFLNXOPXJMZTJ-UHFFFAOYSA-N
Purity 95%+
Complexity 167
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 135.068413911
Heavy Atom Count 10
Hydrogen Bond Acceptor Count 1
Hydrogen Bond Donor Count 0
Monoisotopic Mass 135.068413911
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 22 Ų
Custom Q&A

What are some potential uses of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one?

2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one may have uses in pharmaceuticals, research, or chemical synthesis.

What are the synonyms of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one?

The synonyms of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one are 7-Methyl-2,3-dihydro-1H-pyrrolizin-1-one and 1H-Pyrrolizin-1-one, 2,3-dihydro-7-methyl-.

What is the CAS number of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one?

The CAS number of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one is 6064-85-3.

What is the molecular formula of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one?

The molecular formula of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one is C8H9NO.

What is the molecular weight of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one?

The molecular weight of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one is 135.16.

What category does 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one belong to?

2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one belongs to the category of alkaloids.

What is the chemical structure of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one?

The chemical structure of 2,3-Dihydro-7-methyl-1H-pyrrolizin-1-one is a pyrrolizine ring with a methyl group and a ketone group.

※ Please kindly note that our products are for research use only.