2,3-Dihydrobellendine

Catalog Number	ACM72362471
CAS Number	72362-47-1
Synonyms	Cyclohepta[b]pyran-5,8-imin-4(5H)-one, 2,3,6,7,8,9-hexahydro-3,10-dimethyl- (9CI)
Molecular Weight	207.27
InChI	InChI=1S/C12H17NO2/c1-7-6-15-10-5-8-3-4-9(13(8)2)11(10)12(7)14/h7-9H,3-6H2,1-2H3/t7,8-,9+/m1/s1
InChI Key	MLURGLAIEFYCBG-ASODMVGOSA-N
Purity	95%+
Complexity	348
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	207.125928785
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	CC1COC2=C(C1=O)[C@@H]3CC[C@H](C2)N3C
Monoisotopic Mass	207.125928785
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the chemical formula for 2,3-Dihydrobellendine?

The chemical formula for 2,3-Dihydrobellendine is C12H17NO2.

Can you provide any synonyms for 2,3-Dihydrobellendine?

Some synonyms for 2,3-Dihydrobellendine are Cyclohepta[b]pyran-5,8-imin-4(5H)-one and 2,3,6,7,8,9-hexahydro-3,10-dimethyl-.

What is the Molecular Weight of 2,3-Dihydrobellendine?

The Molecular Weight of 2,3-Dihydrobellendine is 207.27.

What is the CAS number for 2,3-Dihydrobellendine?

The CAS number for 2,3-Dihydrobellendine is 72362-47-1.

What is the predicted boiling point of 2,3-Dihydrobellendine?

The predicted boiling point of 2,3-Dihydrobellendine is 321.3±41.0 °C.

What is the predicted density for 2,3-Dihydrobellendine?

The predicted density for 2,3-Dihydrobellendine is 1.18±0.1 g/cm3.

What is the predicted pKa value for 2,3-Dihydrobellendine?

The predicted pKa value for 2,3-Dihydrobellendine is 7.03±0.40.

What is the predicted physical state of 2,3-Dihydrobellendine at room temperature?

The predicted physical state of 2,3-Dihydrobellendine at room temperature is likely a solid.

How many Carbon atoms are present in the molecular structure of 2,3-Dihydrobellendine?

There are 12 Carbon atoms in the molecular structure of 2,3-Dihydrobellendine.

What is the predicted solubility of 2,3-Dihydrobellendine in water?

The predicted solubility of 2,3-Dihydrobellendine in water is likely low.

※ Please kindly note that our products are for research use only.