2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile

Catalog Number	ACM1380540771
CAS Number	1380540-77-1
Synonyms	(3R)-2,3-Dihydro-4-hydroxy-2-oxo-1H-indole-3-acetonitrile
Molecular Weight	188.18
InChI	InChI=1S/C10H8N2O2/c11-5-4-6-9-7(12-10(6)14)2-1-3-8(9)13/h1-3,6,13H,4H2,(H,12,14)
InChI Key	KJLUDHCNWCIINR-UHFFFAOYSA-N
Complexity	291
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	188.058577502
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	188.058577502
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	73.1 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 1380540-77-1?

The chemical name of the compound is 2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile.

What are the synonyms of 2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile?

The synonyms are (3R)-2,3-Dihydro-4-hydroxy-2-oxo-1H-indole-3-acetonitrile and 1H-Indole-3-acetonitrile, 2,3-dihydro-4-hydroxy-2-oxo-, (3R)-.

What is the molecular formula of 2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile?

The molecular formula is C10H8N2O2.

What is the molecular weight of 2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile?

The molecular weight is 188.18.

What is the boiling point of 2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile?

The predicted boiling point is 385.3±42.0 °C.

What is the predicted density of the compound?

The predicted density is 1.339±0.06 g/cm3.

What is the predicted pKa value of 2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile?

The predicted pKa value is 9.18±0.40.

How many hydrogen atoms are present in 2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile?

There are 8 hydrogen atoms present.

What is the predicted state of 2-(4-Hydroxy-2-oxoindolin-3-yl)acetonitrile at room temperature?

The compound is predicted to be in a solid state at room temperature.

※ Please kindly note that our products are for research use only.