2,6-Tropanediol

Catalog Number	ACM65356027
CAS Number	65356-02-7
Molecular Weight	157.21
InChI	InChI=1S/C8H15NO2/c1-9-5-2-3-7(10)6(9)4-8(5)11/h5-8,10-11H,2-4H2,1H3
InChI Key	ZKNMCJMDJTZIFN-UHFFFAOYSA-N
Purity	95%+
Complexity	162
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	157.110278721
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	157.110278721
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	43.7 Ų

Custom Q&A

What is the chemical formula of 2,6-Tropanediol?

The chemical formula of 2,6-Tropanediol is C8H15NO2.

What is the molecular weight of 2,6-Tropanediol?

The molecular weight of 2,6-Tropanediol is 157.21 g/mol.

In what forms is 2,6-Tropanediol soluble?

2,6-Tropanediol is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What are some synonyms for 2,6-Tropanediol?

Some synonyms for 2,6-Tropanediol include 8-Azabicyclo[3.2.1]octane-2,6-diol, 8-methyl-.

What is the CAS number of 2,6-Tropanediol?

The CAS number of 2,6-Tropanediol is 65356-02-7.

What is the physical form of 2,6-Tropanediol?

2,6-Tropanediol is in the form of oil.

What is the molecular structure of 2,6-Tropanediol?

The molecular structure of 2,6-Tropanediol is not given in the reference.

※ Please kindly note that our products are for research use only.