2-Hydroxy-1-(1H-indol-3-yl)ethanone

Catalog Number	ACM2400513
CAS Number	2400-51-3
Structure
Synonyms	3-Glyceroindole
Molecular Weight	175.18
Molecular Formula	C10H9NO2
InChI	InChI=1S/C10H9NO2/c12-6-10(13)8-5-11-9-4-2-1-3-7(8)9/h1-5,11-12H,6H2
InChI Key	IBLZDDPFMAFWKP-UHFFFAOYSA-N
Purity	95%+
Complexity	205
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	175.06332853
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	175.06332853
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	53.1 Ų

Custom Q&A

What is the chemical formula of 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE?

The chemical formula is C10H9NO2.

What is the molecular weight of 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE?

The molecular weight is 175.18 g/mol.

What is the CAS number of 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE?

The CAS number is 2400-51-3.

What is the melting point of 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE?

The melting point is 160 °C.

What is the predicted boiling point of 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE?

The predicted boiling point is 399.1±17.0 °C.

What is the predicted density of 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE?

The predicted density is 1.338±0.06 g/cm3.

What is the predicted pka value of 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE?

The predicted pka value is 13.25±0.10.

What are some synonyms for 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE?

Some synonyms include CHEMBRDG-BB 5106709, 2-hydroxy-1-(1H-indol-3-yl)ethanone, and 3-(Hydroxyacetyl)-1H-indole.

What is the definition of 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE according to ChEBI?

The definition is that it is a hydroxymethyl indol-3-yl ketone.

What is another name for 2-HYDROXY-1-(1H-INDOL-3-YL)ETHANONE?

Another name is Ethanone, 2-hydroxy-1-(1H-indol-3-yl)-.

※ Please kindly note that our products are for research use only.