2E-Decenoylpiperidide

Catalog Number	ACM147030022
CAS Number	147030-02-2
Synonyms	(E)-1-(1-Oxo-2-decenyl) piperidine
Molecular Weight	237.38
InChI	InChI=1S/C15H27NO/c1-2-3-4-5-6-7-9-12-15(17)16-13-10-8-11-14-16/h9,12H,2-8,10-11,13-14H2,1H3
InChI Key	QBDDXKUFMFRNPR-UHFFFAOYSA-N
Purity	95%+
Complexity	229
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	237.209264485
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	0
Monoisotopic Mass	237.209264485
PhysicalState	Oil
Rotatable Bond Count	7
Topological Polar Surface Area	20.3 Ų

Custom Q&A

What is the chemical name of the compound with CAS number 147030-02-2?

The chemical name is 2-Decen-1-one, 1-(1-piperidinyl)-, (2E)-.

What are the synonyms for the compound 2-Decen-1-one, 1-(1-piperidinyl)-, (2E)-?

The synonyms are 2E-Decenoylpiperidide and (E)-1-(1-oxo-2-decenyl) piperidine.

What is the molecular formula of 2-Decen-1-one, 1-(1-piperidinyl)-, (2E)-?

The molecular formula is C15H27NO.

What is the molecular weight of 2-Decen-1-one, 1-(1-piperidinyl)-, (2E)-?

The molecular weight is 237.38 g/mol.

What is the predicted boiling point of 2-Decen-1-one, 1-(1-piperidinyl)-, (2E)-?

The predicted boiling point is 376.3±9.0 °C.

What is the predicted density of 2-Decen-1-one, 1-(1-piperidinyl)-, (2E)-?

The predicted density is 0.932±0.06 g/cm3.

What is the predicted pka value of 2-Decen-1-one, 1-(1-piperidinyl)-, (2E)-?

The predicted pka value is -0.76±0.20.

What is the estimated LogP value for 2-Decen-1-one, 1-(1-piperidinyl)-, (2E)-?

The estimated LogP value is 4.200.

What is the significance of the (2E) in the chemical name of 2-Decen-1-one, 1-(1-piperidinyl)-, (2E)-?

The (2E) indicates that the double bond in the molecule is in the E configuration.

※ Please kindly note that our products are for research use only.