3-(1,3-Oxazol-5-yl)benzoic acid

Catalog Number	ACM252928828
CAS Number	252928-82-8
Structure
Synonyms	3-(5-Oxazolyl)benzoic acid
Molecular Weight	189.17
Molecular Formula	C10H7NO3
InChI	InChI=1S/C10H7NO3/c12-10(13)8-3-1-2-7(4-8)9-5-11-6-14-9/h1-6H,(H,12,13)
InChI Key	GDGXRJDVOKNSCX-UHFFFAOYSA-N
Melting Point	259-261 °C
Purity	95%
Complexity	219
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	189.042593085
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	189.042593085
PhysicalState	Solid
Rotatable Bond Count	2
Topological Polar Surface Area	63.3 Ų

Custom Q&A

How should 3-(1,3-Oxazol-5-yl)benzoic acid be stored?

It should be stored in an inert atmosphere at room temperature.

What are some synonyms for 3-(1,3-Oxazol-5-yl)benzoic acid?

Some synonyms for 3-(1,3-Oxazol-5-yl)benzoic acid include 3-(5-Oxazolyl)benzoic Acid and 3-(Oxazol-5-yl)benzoic acid.

What is the CAS number for 3-(1,3-Oxazol-5-yl)benzoic acid?

The CAS number is 252928-82-8.

What is the molecular formula of 3-(1,3-Oxazol-5-yl)benzoic acid?

The molecular formula is C10H7NO3.

What is the molecular weight of 3-(1,3-Oxazol-5-yl)benzoic acid?

The molecular weight is 189.17.

What is the melting point of 3-(1,3-Oxazol-5-yl)benzoic acid?

The melting point is 259-261°C.

What is the predicted boiling point of 3-(1,3-Oxazol-5-yl)benzoic acid?

The predicted boiling point is 414.5±28.0°C.

What is the predicted density of 3-(1,3-Oxazol-5-yl)benzoic acid?

The predicted density is 1.320±0.06 g/cm3.

What are the hazard codes and risk statements associated with 3-(1,3-Oxazol-5-yl)benzoic acid?

The hazard code is Xn, and the risk statement is 22.

※ Please kindly note that our products are for research use only.