3,3'-[Iminobis(methylene)]bis-2(3H)furanone

Catalog Number	ACM96562866
CAS Number	96562-86-6
Synonyms	3-[[(2-Oxooxolan-3-yl)methylamino]methyl]oxolan-2-one
Molecular Weight	213.23
InChI	InChI=1S/C10H15NO4/c12-9-7(1-3-14-9)5-11-6-8-2-4-15-10(8)13/h7-8,11H,1-6H2
InChI Key	IEEUZWZOHWPNNG-UHFFFAOYSA-N
Purity	95%+
Complexity	240
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	213.10010796
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Monoisotopic Mass	213.10010796
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	64.6 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 96562-86-6?

The chemical name of the compound is 3,3'-[Iminobis(methylene)]bis-2(3H)furanone.

What are some synonyms for 3,3'-[Iminobis(methylene)]bis-2(3H)furanone?

Some synonyms for the compound include 3-[[(2-oxooxolan-3-yl)methylamino]methyl]oxolan-2-one and 2(3H)-Furanone, 3,3'-[iminobis(methylene)]bis[dihydro- (9CI).

What is the molecular formula of 3,3'-[Iminobis(methylene)]bis-2(3H)furanone?

The molecular formula is C10H15NO4.

What is the molecular weight of 3,3'-[Iminobis(methylene)]bis-2(3H)furanone?

The molecular weight is 213.23 g/mol.

What is the boiling point of 3,3'-[Iminobis(methylene)]bis-2(3H)furanone?

The boiling point is predicted to be 456.2±10.0 °C.

What is the density of 3,3'-[Iminobis(methylene)]bis-2(3H)furanone?

The density is predicted to be 1.218±0.06 g/cm3.

What is the pKa value of 3,3'-[Iminobis(methylene)]bis-2(3H)furanone?

The pKa value is predicted to be 8.52±0.20.

How is 3,3'-[Iminobis(methylene)]bis-2(3H)furanone predicted to behave in terms of boiling point?

It is predicted to have a relatively high boiling point of 456.2±10.0 °C.

What is the predicted acid dissociation constant (pKa) of 3,3'-[Iminobis(methylene)]bis-2(3H)furanone?

The predicted pKa value is 8.52±0.20.

※ Please kindly note that our products are for research use only.