3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone

Catalog Number	ACM94527341
CAS Number	94527-34-1
Synonyms	7,8-Dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one
Molecular Weight	191.18
InChI	InChI=1S/C10H9NO3/c12-10-2-1-6-3-8-9(14-5-13-8)4-7(6)11-10/h3-4H,1-2,5H2,(H,11,12)
InChI Key	DVTJKOLIEHUCKB-UHFFFAOYSA-N
Purity	95%+
Complexity	256
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	191.058243149
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	191.058243149
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	47.6 Ų

Custom Q&A

What is the chemical name of the compound 94527-34-1?

The chemical name is 3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone.

What are some synonyms for 3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone?

Some synonyms are 7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one and 7,8-dihydro-[1,3]dioxolo[4,5-g]quinolin-6(5H)-one.

What is the CAS number for 3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone?

The CAS number is 94527-34-1.

What is the molecular formula of 3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone?

The molecular formula is C10H9NO3.

What is the molecular weight of 3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone?

The molecular weight is 191.18336.

In what forms is 3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone soluble?

The compound is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the physical form of 3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone?

It is in the form of a powder.

How does the solubility of 3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone influence its use in different applications?

The solubility in various solvents affects its potential use in formulations, extraction processes, and chemical reactions.

What are some potential uses of 3,4-Dihydro-6,7-(methylenedioxy)-2(1H)-quinolinone based on its chemical properties?

It may be used as an intermediate in organic synthesis, a research chemical, or in pharmaceutical formulations.

※ Please kindly note that our products are for research use only.