3,4-Dimethoxybenzamide

Catalog Number	ACM1521411
CAS Number	1521-41-1
Structure
Molecular Weight	181.19
InChI	InChI=1S/C9H11NO3/c1-12-7-4-3-6(9(10)11)5-8(7)13-2/h3-5H,1-2H3,(H2,10,11)
InChI Key	XNDZRGTVUVVHQT-UHFFFAOYSA-N
Melting Point	163-164 °C
Purity	95%+
Complexity	184
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	181.07389321
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	181.07389321
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	61.6 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 1521-41-1?

The chemical name is 3,4-DIMETHOXYBENZAMIDE.

What are some synonyms of 3,4-DIMETHOXYBENZAMIDE?

Some synonyms include 3,4-dimethoxy-benzamid, VERATRAMIDE, and BenzaMide, 3,4-diMethoxy.

What is the molecular formula of 3,4-DIMETHOXYBENZAMIDE?

The molecular formula is C9H11NO3.

What is the molecular weight of 3,4-DIMETHOXYBENZAMIDE?

The molecular weight is 181.19 g/mol.

What is the melting point of 3,4-DIMETHOXYBENZAMIDE?

The melting point is 163-164°C.

What is the predicted boiling point of 3,4-DIMETHOXYBENZAMIDE?

The predicted boiling point is 278.4±25.0 °C.

What is the predicted density of 3,4-DIMETHOXYBENZAMIDE?

The predicted density is 1.160±0.06 g/cm3.

How should 3,4-DIMETHOXYBENZAMIDE be stored?

It should be sealed in dry, at room temperature.

What is the predicted pka value of 3,4-DIMETHOXYBENZAMIDE?

The predicted pka value is 16.15±0.50.

What is the EPA Substance Registry System number for 3,4-DIMETHOXYBENZAMIDE?

The EPA Substance Registry System number is 1521-41-1.

※ Please kindly note that our products are for research use only.