3-(9H-Pyrido[3,4-b]indol-1-yl)propanoic acid

3-(9H-Pyrido[3,4-b]indol-1-yl)propanoic acid

Inquiry
Catalog Number ACM89915399
CAS Number 89915-39-9
Structure
Synonyms b-Carboline-1-propanoic acid
Molecular Weight 240.26
InChI InChI=1S/C14H12N2O2/c17-13(18)6-5-12-14-10(7-8-15-12)9-3-1-2-4-11(9)16-14/h1-4,7-8,16H,5-6H2,(H,17,18)
InChI Key CNUHEVWYPKFJHH-UHFFFAOYSA-N
Melting Point 214-215 °C
Purity 95%+
Complexity 321
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 240.08987763
Heavy Atom Count 18
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 2
Monoisotopic Mass 240.08987763
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 66 Ų
Custom Q&A

What is the chemical formula of b-Carboline-1-propanoic acid?

The chemical formula of b-Carboline-1-propanoic acid is C14H12N2O2.

What is the molecular weight of b-Carboline-1-propanoic acid?

The molecular weight of b-Carboline-1-propanoic acid is 240.26.

What is the CAS number of b-Carboline-1-propanoic acid?

The CAS number of b-Carboline-1-propanoic acid is 89915-39-9.

What are some synonyms for b-Carboline-1-propanoic acid?

Some synonyms for b-Carboline-1-propanoic acid are Beta-Carboline-1-propanoic acid, β-Carboline-1-propanoic acid, and 3-(9H-Pyrido[3,4-b]indol-1-yl)propanoic acid.

What is the melting point of b-Carboline-1-propanoic acid?

The melting point of b-Carboline-1-propanoic acid is 214-215°C.

What are the product categories that b-Carboline-1-propanoic acid belongs to?

b-Carboline-1-propanoic acid belongs to the category of alkaloids.

What is the primary usage of beta-carboline-1-propionic acid?

Beta-carboline-1-propionic acid is a harmala alkaloid.

How is beta-carboline-1-propionic acid also known as?

Beta-carboline-1-propionic acid is also known as 9H-Pyrido[3,4-b]indole-1-propanoic acid.

What is beta-carboline-1-propionic acid commonly used for?

Beta-carboline-1-propionic acid is commonly used in chemical synthesis and research.

What is the molecular structure of beta-carboline-1-propionic acid?

The molecular structure of beta-carboline-1-propionic acid contains a pyridoindole ring with a propionic acid side chain.

※ Please kindly note that our products are for research use only.