3-Epiwilsonine

3-Epiwilsonine

Inquiry
Catalog Number ACM39024152
CAS Number 39024-15-2
Structure
Synonyms 1,2-Didehydro-6ξ,7ξ-epoxy-3β,15,16-trimethoxy-C-homoerythrinan
Molecular Weight 343.4
InChI InChI=1S/C20H25NO4/c1-22-14-6-7-20-18(25-20)12-21-8-4-5-13-9-16(23-2)17(24-3)10-15(13)19(20,21)11-14/h6-7,9-10,14,18H,4-5,8,11-12H2,1-3H3/t14-,18+,19+,20+/m0/s1
InChI Key JCKPCZAYDZJZIL-NDSDBLNTSA-N
Purity 95%+
Complexity 568
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 4
Exact Mass 343.17835828
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Isomeric SMILES CO[C@@H]1C[C@]23C4=CC(=C(C=C4CCCN2C[C@@H]5[C@]3(O5)C=C1)OC)OC
Monoisotopic Mass 343.17835828
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 43.5 Ų
Custom Q&A

What is the chemical name for the compound C-Homoerythrinan, 1,2-didehydro-6,7-epoxy-3,15,16-trimethoxy-, (3beta, 6xi)-?

The chemical name is C-Homoerythrinan, 1,2-didehydro-6,7-epoxy-3,15,16-trimethoxy-, (3beta, 6xi)-.

What are some synonyms for C-Homoerythrinan, 1,2-didehydro-6,7-epoxy-3,15,16-trimethoxy-?

Some synonyms include Alkaloid PC-VII and 3-Epiwilsonine.

What is the CAS number for C-Homoerythrinan, 1,2-didehydro-6,7-epoxy-3,15,16-trimethoxy-?

The CAS number is 39024-15-2.

What is the molecular formula of C-Homoerythrinan, 1,2-didehydro-6,7-epoxy-3,15,16-trimethoxy-?

The molecular formula is C20H25NO4.

What is the predicted boiling point of C-Homoerythrinan, 1,2-didehydro-6,7-epoxy-3,15,16-trimethoxy-?

The predicted boiling point is 474.8±45.0 °C.

In what solvents is C-Homoerythrinan soluble?

It is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of C-Homoerythrinan?

It is in the form of oil.

What is the predicted pka value for C-Homoerythrinan?

The predicted pka value is 6.07±0.40.

What is the melting point of C-Homoerythrinan?

The melting point is 103-4°C.

What is the specific rotation of C-Homoerythrinan in different solvents?

It is dextrorotatory with [α]D +60.7° (c 0.85, CHC13) or +75.8° (c 0.52, EtOH).

※ Please kindly note that our products are for research use only.