3-Hydroxy-2-phenyl-propanamide

Catalog Number	ACM56598620
CAS Number	56598-62-0
Molecular Weight	165.19
InChI	InChI=1S/C9H11NO2/c10-9(12)8(6-11)7-4-2-1-3-5-7/h1-5,8,11H,6H2,(H2,10,12)
InChI Key	JJCZGVLYNIVKKD-UHFFFAOYSA-N
Purity	95%+
Complexity	153
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	165.078978594
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	165.078978594
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	63.3 Ų

Custom Q&A

What is the chemical name of 3-hydroxy-2-phenyl-propanamide?

The chemical name of 3-hydroxy-2-phenyl-propanamide is 3-hydroxy-2-phenyl-propanamide.

What are the synonyms for 3-hydroxy-2-phenyl-propanamide?

The synonyms for 3-hydroxy-2-phenyl-propanamide are 3-hydroxy-2-phenyl-propanamide.

What is the CAS number for 3-hydroxy-2-phenyl-propanamide?

The CAS number for 3-hydroxy-2-phenyl-propanamide is 2019-54-7.

What is the molecular formula of 3-hydroxy-2-phenyl-propanamide?

The molecular formula of 3-hydroxy-2-phenyl-propanamide is C9H11NO2.

. What is the significance of the chemical formula C9H11NO2?

The chemical formula C9H11NO2 provides information about the composition of 3-hydroxy-2-phenyl-propanamide in terms of its elements and their ratio.

How is 3-hydroxy-2-phenyl-propanamide commonly used?

3-hydroxy-2-phenyl-propanamide is commonly used as a pharmaceutical intermediate in the synthesis of certain compounds.

※ Please kindly note that our products are for research use only.