3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one

Catalog Number	ACM33417173
CAS Number	33417-17-3
Structure
Synonyms	3-Hydroxy-3-acetonyl-2-oxindole
Molecular Weight	205.21
InChI	InChI=1S/C11H11NO3/c1-7(13)6-11(15)8-4-2-3-5-9(8)12-10(11)14/h2-5,15H,6H2,1H3,(H,12,14)
InChI Key	CBMTTXBZZZABGG-UHFFFAOYSA-N
Melting Point	167-168 °C
Purity	95%+
Complexity	302
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	205.07389321
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	205.07389321
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	66.4 Ų

Custom Q&A

What is the molecular formula of 3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one?

The molecular formula is C11H11NO3.

What is the molecular weight of 3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one?

The molecular weight is 205.21.

What are some synonyms for 3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one?

Some synonyms include TIMTEC-BB SBB000446, IFLAB-BB F1918-0060, and AKOS BC-1539.

What are the hazard codes associated with 3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one?

The hazard code is Xi.

What is the hazard class of 3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one?

The hazard class is irritant.

What can be inferred from the hazard code Xi associated with 3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one?

The substance is considered to be irritating.

What is the significance of the molecular formula C11H11NO3 in relation to 3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one?

The molecular formula provides information about the composition of atoms in the compound.

Why is it important to be aware of the synonyms of 3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one?

Knowing the synonyms can help in identifying the compound in different contexts and databases.

How might the safety information for 3-Hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one be used in handling the compound?

The safety information can guide proper handling procedures to minimize risk of exposure to potential hazards.

※ Please kindly note that our products are for research use only.