3'-Hydroxyrocaglamide

Catalog Number	ACM189322676
CAS Number	189322-67-6
Synonyms	C-3'-Hydroxyrocaglamide
IUPAC Name	(1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-N,N-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide
Molecular Weight	521.56
Molecular Formula	C29H31NO8
Canonical SMILES	CN(C)C(=O)[C@@H]1[C@H]([C@]2([C@@]([C@@H]1O)(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC(=C(C=C4)OC)O)C5=CC=CC=C5
InChI	InChI=1S/C29H31NO8/c1-30(2)27(33)23-24(16-9-7-6-8-10-16)29(17-11-12-20(36-4)19(31)13-17)28(34,26(23)32)25-21(37-5)14-18(35-3)15-22(25)38-29/h6-15,23-24,26,31-32,34H,1-5H3/t23-,24-,26-,28+,29+/m1/s1
InChI Key	VOSHNPGEFUCUHH-IDAMAFBJSA-N
Boiling Point	704.8±60.0 °C
Purity	98%
Density	1.368±0.06 g/ml
Appearance	Solid
Complexity	850
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	521.20496695
Heavy Atom Count	38
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	3
Isomeric SMILES	CN(C)C(=O)[C@@H]1[C@H]([C@]2([C@@]([C@@H]1O)(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC(=C(C=C4)OC)O)C5=CC=CC=C5
Monoisotopic Mass	521.20496695
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	118 Ų

Custom Q&A

What is the chemical formula for 3'-Hydroxyrocaglamide?

The chemical formula for 3'-Hydroxyrocaglamide is C29H31NO8.

What is the molecular weight of 3'-Hydroxyrocaglamide?

The molecular weight of 3'-Hydroxyrocaglamide is 521.56.

What is the CAS number for 3'-Hydroxyrocaglamide?

The CAS number for 3'-Hydroxyrocaglamide is 189322-67-6.

What are some synonyms for 3'-Hydroxyrocaglamide?

Some synonyms for 3'-Hydroxyrocaglamide are C-3'-Hydroxyrocaglamide, Rocaglamide C, and Rocaglamide D.

What is the boiling point of 3'-Hydroxyrocaglamide?

The boiling point of 3'-Hydroxyrocaglamide is predicted to be 704.8±60.0°C.

In what solvents is 3'-Hydroxyrocaglamide soluble in?

3'-Hydroxyrocaglamide is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the physical form of 3'-Hydroxyrocaglamide?

The physical form of 3'-Hydroxyrocaglamide is a white to off-white sticky solid.

What is the predicted pka value of 3'-Hydroxyrocaglamide?

The predicted pka value of 3'-Hydroxyrocaglamide is 9.85±0.10.

What is Rocaglamide C used for?

Rocaglamide C is a derivative of Rocaglamide.

How can 3'-Hydroxyrocaglamide be classified based on its chemical properties?

3'-Hydroxyrocaglamide can be classified as a white to off-white sticky solid, soluble in various solvents including Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, with a predicted pka value of 9.85±0.10.

※ Please kindly note that our products are for research use only.