3-Indoxyl-beta-D-glucopyranoside

Catalog Number	ACM487605
CAS Number	487-60-5
Synonyms	1H-Indol-3-yl β-D-glucopyranoside
IUPAC Name	(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(1H-indol-3-yloxy)oxane-3,4,5-triol
Molecular Weight	295.29
Molecular Formula	C14H17NO6
Canonical SMILES	C1=CC=C2C(=C1)C(=CN2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O
InChI	InChI=1S/C14H17NO6/c16-6-10-11(17)12(18)13(19)14(21-10)20-9-5-15-8-4-2-1-3-7(8)9/h1-5,10-19H,6H2/t10-,11-,12+,13-,14-/m1/s1
InChI Key	XVARCVCWNFACQC-RKQHYHRCSA-N
Boiling Point	606.7±55.0 °C
Melting Point	57-58 °C
Purity	98%
Density	1.562±0.06 g/ml
Appearance	White to pale grey solid
Complexity	356
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	295.10558726
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	5
Isomeric SMILES	C1=CC=C2C(=C1)C(=CN2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O
Monoisotopic Mass	295.10558726
PhysicalState	Solid
Rotatable Bond Count	3
Topological Polar Surface Area	115 Ų

Custom Q&A

What is the chemical formula of 3-Indoxyl-beta-D-glucopyranoside?

The chemical formula of 3-Indoxyl-beta-D-glucopyranoside is C14H17NO6.

What is the molecular weight of 3-Indoxyl-beta-D-glucopyranoside?

The molecular weight of 3-Indoxyl-beta-D-glucopyranoside is 295.29 g/mol.

What is the melting point of 3-Indoxyl-beta-D-glucopyranoside?

The melting point of 3-Indoxyl-beta-D-glucopyranoside is 57-58°C.

What is the boiling point of 3-Indoxyl-beta-D-glucopyranoside?

The predicted boiling point of 3-Indoxyl-beta-D-glucopyranoside is 606.7±55.0°C.

What is the solubility of 3-Indoxyl-beta-D-glucopyranoside in water?

3-Indoxyl-beta-D-glucopyranoside is soluble in water: 0.1 M at 20°C, clear to slightly hazy, colorless to faint yellow-green.

What is the form of 3-Indoxyl-beta-D-glucopyranoside?

3-Indoxyl-beta-D-glucopyranoside is in the form of a solid.

What is the safety statement associated with 3-Indoxyl-beta-D-glucopyranoside?

The safety statements for 3-Indoxyl-beta-D-glucopyranoside are 22-24/25.

What is the usage of 3-Indoxyl-beta-D-glucopyranoside?

3-Indoxyl-beta-D-glucopyranoside is used as a colorimetric substrate for laminarinase.

In what Chinese medicinal herb is Indoxyl-β-D-glucoside found?

Indoxyl-β-D-glucoside is a constituent of Isatis indigotica, a Chinese medicinal herb.

What is the definition of Indican?

Indican is an indolyl carbohydrate, a beta-D-glucoside, and an exopolysaccharide according to ChEBI.

※ Please kindly note that our products are for research use only.