3-Methoxyoxohernandaline

Catalog Number	ACM872729345
CAS Number	872729-34-5
Synonyms	Benzaldehyde, 4,5-dimethoxy-2-[(1,2,3,10-tetramethoxy-7-oxo-7H-dibenzo[de,g]quinolin-9-yl)oxy]-
IUPAC Name	4,5-dimethoxy-2-[(4,14,15,16-tetramethoxy-8-oxo-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-5-yl)oxy]benzaldehyde
Molecular Weight	531.51
Molecular Formula	C29H25NO9
Canonical SMILES	COC1=C(C=C(C(=C1)C=O)OC2=C(C=C3C(=C2)C(=O)C4=NC=CC5=C4C3=C(C(=C5OC)OC)OC)OC)OC
InChI	InChI=1S/C29H25NO9/c1-33-19-9-14(13-31)18(12-21(19)35-3)39-22-11-17-16(10-20(22)34-2)24-23-15(7-8-30-25(23)26(17)32)27(36-4)29(38-6)28(24)37-5/h7-13H,1-6H3
InChI Key	OULKCFNJYHCFPY-UHFFFAOYSA-N
Purity	98%
Appearance	Solid
Complexity	859
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	531.15293138
Heavy Atom Count	39
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	0
Monoisotopic Mass	531.15293138
PhysicalState	Powder
Rotatable Bond Count	9
Topological Polar Surface Area	112 Ų

Custom Q&A

What is the chemical name of the compound 3-Methoxyoxohernandaline?

The chemical name of the compound is Benzaldehyde, 4,5-dimethoxy-2-[(1,2,3,10-tetramethoxy-7-oxo-7H-dibenzo[de,g]quinolin-9-yl)oxy]-

What is the PubChem ID of 3-Methoxyoxohernandaline?

The PubChem ID is 134715260.

How is 3-Methoxyoxohernandaline represented in chemical notation?

It is represented as C29H25NO9 in chemical notation.

What is the molecular weight of 3-Methoxyoxohernandaline?

The molecular weight is 531.51.

What is the CAS number of 3-Methoxyoxohernandaline?

The CAS number is 872729-34-5.

How many oxygen atoms are present in the chemical formula of 3-Methoxyoxohernandaline?

There are nine oxygen atoms present in the chemical formula.

What is the molecular formula of 3-Methoxyoxohernandaline?

The molecular formula is C29H25NO9.

What are the common synonyms for 3-Methoxyoxohernandaline?

The common synonyms include 3-Methoxyoxohernandaline.

What are the chemical properties of 3-Methoxyoxohernandaline based on the information provided?

The compound has a complex chemical structure with multiple methoxy and oxo groups, indicating a potential for diverse chemical reactivity.

※ Please kindly note that our products are for research use only.