3-Methyl-7-propylxanthine

Catalog Number	ACM55242643
CAS Number	55242-64-3
Structure
Synonyms	3-Methyl-7-propyl-3,7-dihydro-1H-purine-2,6-dione
Molecular Weight	208.22
Molecular Formula	C9H12N4O2
InChI	InChI=1S/C9H12N4O2/c1-3-4-13-5-10-7-6(13)8(14)11-9(15)12(7)2/h5H,3-4H2,1-2H3,(H,11,14,15)
InChI Key	MHNVSFOURBQRPK-UHFFFAOYSA-N
Melting Point	250-252 °C
Purity	98%+
Complexity	294
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	208.09602564
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	208.09602564
PhysicalState	Solid
Rotatable Bond Count	2
Topological Polar Surface Area	67.2 Ų

Custom Q&A

What is the chemical formula of 3-Methyl-7-propylxanthine?

The chemical formula of 3-Methyl-7-propylxanthine is C9H12N4O2.

What is the molecular weight of 3-Methyl-7-propylxanthine?

The molecular weight of 3-Methyl-7-propylxanthine is 208.22 g/mol.

What is the melting point of 3-Methyl-7-propylxanthine?

The melting point of 3-Methyl-7-propylxanthine is 250-252 °C.

What is the density of 3-Methyl-7-propylxanthine?

The density of 3-Methyl-7-propylxanthine is 1.44±0.1 g/cm3.

In what form does 3-Methyl-7-propylxanthine exist?

3-Methyl-7-propylxanthine exists in solid form.

How is 3-Methyl-7-propylxanthine stored?

3-Methyl-7-propylxanthine should be sealed in dry, at room temperature for storage.

What is one of the uses of 3-Methyl-7-propylxanthine?

3-Methyl-7-propylxanthine can be used in hair tonics compositions.

What is another use of 3-Methyl-7-propylxanthine?

3-Methyl-7-propylxanthine is used as an intermediate for the vasodilator propentofylline.

How does 3-Methyl-7-propylxanthine solubility change when heated or sonicated?

It is slightly soluble in DMSO when heated or sonicated.

What is the predicted pka value of 3-Methyl-7-propylxanthine?

The predicted pka value of 3-Methyl-7-propylxanthine is 9.91±0.70.

※ Please kindly note that our products are for research use only.