3-Methyl-9H-carbazol-2-ol

Catalog Number	ACM24224304
CAS Number	24224-30-4
Structure
Synonyms	2-Hydroxy-3-methylcarbazole
Molecular Weight	197.23
InChI	InChI=1S/C13H11NO/c1-8-6-10-9-4-2-3-5-11(9)14-12(10)7-13(8)15/h2-7,14-15H,1H3
InChI Key	ZLOJFAGTWDOURE-UHFFFAOYSA-N
Melting Point	245-246 °C
Purity	95%+
Complexity	243
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	197.084063974
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	2
Monoisotopic Mass	197.084063974
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	36 Ų

Custom Q&A

What is the chemical formula for 3-methyl-9H-carbazol-2-ol?

The chemical formula for 3-methyl-9H-carbazol-2-ol is C13H11NO.

What is the molecular weight of 3-methyl-9H-carbazol-2-ol?

The molecular weight of 3-methyl-9H-carbazol-2-ol is 197.23 g/mol.

What is the melting point of 3-methyl-9H-carbazol-2-ol?

The melting point of 3-methyl-9H-carbazol-2-ol is 245-246 °C.

What is the predicted boiling point of 3-methyl-9H-carbazol-2-ol?

The predicted boiling point of 3-methyl-9H-carbazol-2-ol is 430.8±25.0 °C.

What is the predicted density of 3-methyl-9H-carbazol-2-ol?

The predicted density of 3-methyl-9H-carbazol-2-ol is 1.308±0.06 g/cm3.

What is the predicted pka value of 3-methyl-9H-carbazol-2-ol?

The predicted pka value of 3-methyl-9H-carbazol-2-ol is 10.39±0.30.

What is another name for 3-methyl-9H-carbazol-2-ol?

Another name for 3-methyl-9H-carbazol-2-ol is 2-Hydroxy-3-methylcarbazole.

What is the CAS number for 3-methyl-9H-carbazol-2-ol?

The CAS number for 3-methyl-9H-carbazol-2-ol is 24224-30-4.

What is the definition of 3-methyl-9H-carbazol-2-ol according to ChEBI?

According to ChEBI, 3-methyl-9H-carbazol-2-ol is a member of carbazoles.

※ Please kindly note that our products are for research use only.