3-Phenyl-1-(pyrrol-1-yl)propan-1-one

Catalog Number	ACM112448698
CAS Number	112448-69-8
Synonyms	1-(1-Oxo-3-phenylpropyl)-1H-pyrrole
IUPAC Name	3-Phenyl-1-pyrrol-1-ylpropan-1-one
Molecular Weight	199.25
Molecular Formula	C13H13NO
Canonical SMILES	C1=CC=C(C=C1)CCC(=O)N2C=CC=C2
InChI	InChI=1S/C13H13NO/c15-13(14-10-4-5-11-14)9-8-12-6-2-1-3-7-12/h1-7,10-11H,8-9H2
InChI Key	NALOIBRUQZVZKV-UHFFFAOYSA-N
Melting Point	46-48 °C
Purity	98%
Appearance	Solid
Complexity	203
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	199.099714038
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	0
Monoisotopic Mass	199.099714038
PhysicalState	Solid
Rotatable Bond Count	2
Topological Polar Surface Area	22 Ų

Custom Q&A

What is the chemical formula for 3-Phenyl-1-(pyrrol-1-yl)propan-1-one?

The chemical formula is C13H13NO.

What is the molecular weight of 3-Phenyl-1-(pyrrol-1-yl)propan-1-one?

The molecular weight is 199.25.

What is the CAS number for 3-Phenyl-1-(pyrrol-1-yl)propan-1-one?

The CAS number is 112448-69-8.

What are the synonyms for 3-Phenyl-1-(pyrrol-1-yl)propan-1-one?

Some synonyms include 1-(1-Oxo-3-phenylpropyl)-1H-pyrrole and 3-PHENYL-1-(PYRROL-1-YL)PROPAN-1.

What is the melting point of 3-Phenyl-1-(pyrrol-1-yl)propan-1-one?

The melting point is 46-48℃.

What is the molecular formula for 3-Phenyl-1-(pyrrol-1-yl)propan-1-one?

The molecular formula is C13H13NO.

Is 3-Phenyl-1-(pyrrol-1-yl)propan-1-one a solid, liquid, or gas at room temperature?

It is a solid at room temperature.

Are there any other chemical properties mentioned for 3-Phenyl-1-(pyrrol-1-yl)propan-1-one?

No, only the melting point is mentioned.

Why is the melting point of 3-Phenyl-1-(pyrrol-1-yl)propan-1-one important?

The melting point can indicate the purity of the compound and its stability under certain conditions.

※ Please kindly note that our products are for research use only.