3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)-(9CI)

Catalog Number	ACM126424768
CAS Number	126424-76-8
Molecular Weight	123.15
InChI	InChI=1S/C7H9NO/c9-7-4-3-6-2-1-5-8(6)7/h3-4,6H,1-2,5H2/t6-/m1/s1
InChI Key	FVZBHZCORGROSI-ZCFIWIBFSA-N
Melting Point	56-58 °C
Purity	95%+
Complexity	174
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	123.068413911
Heavy Atom Count	9
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	0
Isomeric SMILES	C1C[C@@H]2C=CC(=O)N2C1
Monoisotopic Mass	123.068413911
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	20.3 Ų

Custom Q&A

What is the chemical name of the compound with the 9CI name 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)?

The chemical name is 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR).

What are some synonyms for 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)?

Some synonyms include 3H-Pyrrolizin-3-one, 5,6,7,7a-tetrahydro-, (7aR)-.

What is the CAS number for 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)?

The CAS number is 126424-76-8.

What is the molecular formula of 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)?

The molecular formula is C7H9NO.

What is the molecular weight of 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)?

The molecular weight is 123.15.

What are the product categories that 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR) listed under?

The product categories include PYRROLIDINE and AMINETERTIARY.

What is the melting point of 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)?

The melting point is 56-58 °C.

What is the predicted boiling point of 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)?

The predicted boiling point is 289.4±10.0 °C.

What is the predicted density of 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)?

The predicted density is 1.17±0.1 g/cm3.

What is the predicted pka value of 3H-Pyrrolizin-3-one,5,6,7,7a-tetrahydro-,(7aR)?

The predicted pka value is -0.91±0.20.

※ Please kindly note that our products are for research use only.