4,9-Dimethoxycanthin-6-one

Catalog Number	ACM1270001723
CAS Number	1270001-72-3
Synonyms	4,9-Dimethoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one
Molecular Weight	280.28
InChI	InChI=1S/C16H12N2O3/c1-20-9-3-4-10-11-5-6-17-15-13(21-2)8-14(19)18(16(11)15)12(10)7-9/h3-8H,1-2H3
InChI Key	WBMNWMYQWQQWHM-UHFFFAOYSA-N
Purity	95%+
Complexity	478
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	280.08479225
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	280.08479225
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	53.4 Ų

Custom Q&A

What is the pka value for this compound?

The predicted pka value is 4.05±0.20.

What are some synonyms for 4,9-Dimethoxycanthin-6-one?

Some synonyms include 4,9-Dimethoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one and 6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 4,9-dimethoxy-.

What is the PubChem ID for 4,9-Dimethoxycanthin-6-one?

The PubChem ID is 102004796.

What is the CAS number for 4,9-Dimethoxycanthin-6-one?

The CAS number is 1270001-72-3.

What is the molecular formula of 4,9-Dimethoxycanthin-6-one?

The molecular formula is C16H12N2O3.

What is the molecular weight of this compound?

The molecular weight is 280.28 g/mol.

What is the boiling point of 4,9-Dimethoxycanthin-6-one?

The predicted boiling point is 430.3±45.0 °C.

What is the density of 4,9-Dimethoxycanthin-6-one?

The predicted density is 1.40±0.1 g/cm3.

※ Please kindly note that our products are for research use only.