4'-Demethoxypiperlotine C

Catalog Number	ACM807372389
CAS Number	807372-38-9
Synonyms	(2E)-3-(3,5-Dimethoxyphenyl)-1-(1-pyrrolidinyl)-2-propen-1-one
Molecular Weight	261.32
InChI	InChI=1S/C15H19NO3/c1-18-13-9-12(10-14(11-13)19-2)5-6-15(17)16-7-3-4-8-16/h5-6,9-11H,3-4,7-8H2,1-2H3/b6-5+
InChI Key	BRRDATYVUWMJSQ-AATRIKPKSA-N
Purity	95%+
Complexity	311
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	261.13649347
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	COC1=CC(=CC(=C1)/C=C/C(=O)N2CCCC2)OC
Monoisotopic Mass	261.13649347
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	38.8 Ų

Custom Q&A

What is the chemical name of 4'-DeMethoxypiperlotine C?

The chemical name of 4'-DeMethoxypiperlotine C is (2E)-3-(3,5-Dimethoxyphenyl)-1-(1-pyrrolidinyl)-2-propen-1-one.

What are the synonyms for 4'-DeMethoxypiperlotine C?

The synonyms for 4'-DeMethoxypiperlotine C are 4'-DeMethoxypiperlotine C and -Demethoxypiperlotine C.

What is the CAS number for 4'-DeMethoxypiperlotine C?

The CAS number for 4'-DeMethoxypiperlotine C is 807372-38-9.

What is the molecular formula of 4'-DeMethoxypiperlotine C?

The molecular formula of 4'-DeMethoxypiperlotine C is C15H19NO3.

What is the molecular weight of 4'-DeMethoxypiperlotine C?

The molecular weight of 4'-DeMethoxypiperlotine C is 261.32.

What is the predicted boiling point of 4'-DeMethoxypiperlotine C?

The predicted boiling point of 4'-DeMethoxypiperlotine C is 465.9±33.0 °C.

What is the predicted density of 4'-DeMethoxypiperlotine C?

The predicted density of 4'-DeMethoxypiperlotine C is 1.146±0.06 g/cm3.

What is the predicted pKa value of 4'-DeMethoxypiperlotine C?

The predicted pKa value of 4'-DeMethoxypiperlotine C is -0.91±0.20.

※ Please kindly note that our products are for research use only.